2-Acetamido-4,4,4-trifluorobutanoic acid
2-Acetamido-4,4,4-trifluorobutanoic acid structure
|
Common Name | 2-Acetamido-4,4,4-trifluorobutanoic acid | ||
|---|---|---|---|---|
| CAS Number | 120097-65-6 | Molecular Weight | 199.128 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 343.3±42.0 °C at 760 mmHg | |
| Molecular Formula | C6H8F3NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 161.4±27.9 °C | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-Acetamido-4,4,4-trifluorobutanoic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 343.3±42.0 °C at 760 mmHg |
| Molecular Formula | C6H8F3NO3 |
| Molecular Weight | 199.128 |
| Flash Point | 161.4±27.9 °C |
| Exact Mass | 199.045624 |
| PSA | 66.40000 |
| LogP | 0.69 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Index of Refraction | 1.404 |
| InChIKey | BCCRZHTXNJUSFS-UHFFFAOYSA-N |
| SMILES | CC(=O)NC(CC(F)(F)F)C(=O)O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~89%
2-Acetamido-4,4... CAS#:120097-65-6 |
| Literature: Tsushima; Kawada; Ishihara; Uchida; Shiratori; Higaki; Hirata Tetrahedron, 1988 , vol. 44, # 17 p. 5375 - 5387 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 1 | |
CAS#:15960-05-1This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-Acetamido-4,4,4-trifluorobutanoic acid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 2-Acetamido-4,4,4-trifluorobutanoic acid? |
| A: Molecular formula of 2-Acetamido-4,4,4-trifluorobutanoic acid is C6H8F3NO3. |
| Q: What is the CAS number of 2-Acetamido-4,4,4-trifluorobutanoic acid? |
| A: CAS number of 2-Acetamido-4,4,4-trifluorobutanoic acid is 120097-65-6. |
| Q: What is the LogP of 2-Acetamido-4,4,4-trifluorobutanoic acid? |
| A: LogP of 2-Acetamido-4,4,4-trifluorobutanoic acid is 0.69. |
| Q: What is the SMILES notation of 2-Acetamido-4,4,4-trifluorobutanoic acid? |
| A: SMILES notation of 2-Acetamido-4,4,4-trifluorobutanoic acid is CC(=O)NC(CC(F)(F)F)C(=O)O. |
| Q: What are the upstream materials of 2-Acetamido-4,4,4-trifluorobutanoic acid? |
| A: Related upstream materials(CAS) of 2-Acetamido-4,4,4-trifluorobutanoic acid: 15959-93-0;108-24-7. |
| Q: What are the downstream products of 2-Acetamido-4,4,4-trifluorobutanoic acid? |
| A: Related downstream products(CAS) of 2-Acetamido-4,4,4-trifluorobutanoic acid: 15960-05-1. |
| Q: What is the molecular weight of 2-Acetamido-4,4,4-trifluorobutanoic acid? |
| A: Molecular weight of 2-Acetamido-4,4,4-trifluorobutanoic acid is 199.128. |
| Q: What is the boiling point of 2-Acetamido-4,4,4-trifluorobutanoic acid? |
| A: Boiling point of 2-Acetamido-4,4,4-trifluorobutanoic acid is 343.3±42.0 °C at 760 mmHg. |
| Q: What is the English name of 2-Acetamido-4,4,4-trifluorobutanoic acid? |
| A: The English name of 2-Acetamido-4,4,4-trifluorobutanoic acid is 2-Acetamido-4,4,4-trifluorobutanoic acid. |
| Q: What English synonyms does 2-Acetamido-4,4,4-trifluorobutanoic acid have? |
| A: English synonyms of 2-Acetamido-4,4,4-trifluorobutanoic acid: 2-Acetamido-4,4,4-trifluorobutanoic acid. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |