(4-chlorophenyl)(mesityl)iodonium trifluoromethanesulfonate
(4-chlorophenyl)(mesityl)iodonium trifluoromethanesulfonate structure
|
Common Name | (4-chlorophenyl)(mesityl)iodonium trifluoromethanesulfonate | ||
|---|---|---|---|---|
| CAS Number | 1204518-00-2 | Molecular Weight | 506.70600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H15ClF3IO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: (4-Chlorophenyl)(mesityl)iodonium trifluoromethanesulfonate, CAS: 1204518-00-2, molecular formula: C16H15ClF3IO3S, molecular weight: 506.71, For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (4-chlorophenyl)(mesityl)iodonium trifluoromethanesulfonate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H15ClF3IO3S |
|---|---|
| Molecular Weight | 506.70600 |
| Exact Mass | 505.94300 |
| PSA | 65.58000 |
| LogP | 6.40750 |
| InChIKey | MPWRPWNXMQSKNQ-UHFFFAOYSA-M |
| SMILES | Cc1cc(C)c([I+]c2ccc(Cl)cc2)c(C)c1.O=S(=O)([O-])C(F)(F)F |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:106-46-7
CAS#:106-39-8This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| .4-chlorophenyl(mesityl)iodonium triflate |
| .(4-chlorophenyl)(mesityl)iodonium triflate |
| 4-chlorophenyl(mesityl)iodonium trifluoromethanesulfonate |
| .mesityl(4-chlorophenyl)iodonium triflate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of (4-chlorophenyl)(mesityl)iodonium trifluoromethanesulfonate? |
| A: InChIKey of (4-chlorophenyl)(mesityl)iodonium trifluoromethanesulfonate is MPWRPWNXMQSKNQ-UHFFFAOYSA-M. |
| Q: What is the SMILES notation of (4-chlorophenyl)(mesityl)iodonium trifluoromethanesulfonate? |
| A: SMILES notation of (4-chlorophenyl)(mesityl)iodonium trifluoromethanesulfonate is Cc1cc(C)c([I+]c2ccc(Cl)cc2)c(C)c1.O=S(=O)([O-])C(F)(F)F. |
| Q: What is the LogP of (4-chlorophenyl)(mesityl)iodonium trifluoromethanesulfonate? |
| A: LogP of (4-chlorophenyl)(mesityl)iodonium trifluoromethanesulfonate is 6.40750. |
| Q: What is the English name of (4-chlorophenyl)(mesityl)iodonium trifluoromethanesulfonate? |
| A: The English name of (4-chlorophenyl)(mesityl)iodonium trifluoromethanesulfonate is (4-chlorophenyl)(mesityl)iodonium trifluoromethanesulfonate. |
| Q: What is the Chinese name of 1204518-00-2? |
| A: Chinese name of 1204518-00-2 is 1204518-00-2. |
| Q: What is the CAS number of (4-chlorophenyl)(mesityl)iodonium trifluoromethanesulfonate? |
| A: CAS number of (4-chlorophenyl)(mesityl)iodonium trifluoromethanesulfonate is 1204518-00-2. |
| Q: What English synonyms does (4-chlorophenyl)(mesityl)iodonium trifluoromethanesulfonate have? |
| A: English synonyms of (4-chlorophenyl)(mesityl)iodonium trifluoromethanesulfonate: .4-chlorophenyl(mesityl)iodonium triflate, .(4-chlorophenyl)(mesityl)iodonium triflate, 4-chlorophenyl(mesityl)iodonium trifluoromethanesulfonate, .mesityl(4-chlorophenyl)iodonium triflate. |
| Q: What is the molecular weight of (4-chlorophenyl)(mesityl)iodonium trifluoromethanesulfonate? |
| A: Molecular weight of (4-chlorophenyl)(mesityl)iodonium trifluoromethanesulfonate is 506.70600. |
| Q: What is the polar surface area (PSA) of (4-chlorophenyl)(mesityl)iodonium trifluoromethanesulfonate? |
| A: Polar surface area (PSA) of (4-chlorophenyl)(mesityl)iodonium trifluoromethanesulfonate is 65.58000. |
| Q: What is the molecular formula of (4-chlorophenyl)(mesityl)iodonium trifluoromethanesulfonate? |
| A: Molecular formula of (4-chlorophenyl)(mesityl)iodonium trifluoromethanesulfonate is C16H15ClF3IO3S. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |