2-(2,6-Difluoro-4-nitrophenyl)propanoic acid
2-(2,6-Difluoro-4-nitrophenyl)propanoic acid structure
|
Common Name | 2-(2,6-Difluoro-4-nitrophenyl)propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 1226776-82-4 | Molecular Weight | 231.15300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H7F2NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(2,6-Difluoro-4-nitrophenyl)propanoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H7F2NO4 |
|---|---|
| Molecular Weight | 231.15300 |
| Exact Mass | 231.03400 |
| PSA | 83.12000 |
| LogP | 2.58430 |
| InChIKey | BLZPGURBRHOGGM-UHFFFAOYSA-N |
| SMILES | CC(C(=O)O)c1c(F)cc([N+](=O)[O-])cc1F |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 2-(2,6-Difluoro-4-nitrophenyl)propanoic acid? |
| A: Molecular formula of 2-(2,6-Difluoro-4-nitrophenyl)propanoic acid is C9H7F2NO4. |
| Q: What is the English name of 2-(2,6-Difluoro-4-nitrophenyl)propanoic acid? |
| A: The English name of 2-(2,6-Difluoro-4-nitrophenyl)propanoic acid is 2-(2,6-Difluoro-4-nitrophenyl)propanoic acid. |
| Q: What is the Chinese name of 1226776-82-4? |
| A: Chinese name of 1226776-82-4 is 1226776-82-4. |
| Q: What is the LogP of 2-(2,6-Difluoro-4-nitrophenyl)propanoic acid? |
| A: LogP of 2-(2,6-Difluoro-4-nitrophenyl)propanoic acid is 2.58430. |
| Q: What is the molecular weight of 2-(2,6-Difluoro-4-nitrophenyl)propanoic acid? |
| A: Molecular weight of 2-(2,6-Difluoro-4-nitrophenyl)propanoic acid is 231.15300. |
| Q: What are the upstream materials of 2-(2,6-Difluoro-4-nitrophenyl)propanoic acid? |
| A: Related upstream materials(CAS) of 2-(2,6-Difluoro-4-nitrophenyl)propanoic acid: 1256455-23-8;66684-58-0. |
| Q: What is the CAS number of 2-(2,6-Difluoro-4-nitrophenyl)propanoic acid? |
| A: CAS number of 2-(2,6-Difluoro-4-nitrophenyl)propanoic acid is 1226776-82-4. |
| Q: What is the InChIKey of 2-(2,6-Difluoro-4-nitrophenyl)propanoic acid? |
| A: InChIKey of 2-(2,6-Difluoro-4-nitrophenyl)propanoic acid is BLZPGURBRHOGGM-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of 2-(2,6-Difluoro-4-nitrophenyl)propanoic acid? |
| A: Polar surface area (PSA) of 2-(2,6-Difluoro-4-nitrophenyl)propanoic acid is 83.12000. |
| Q: What is the SMILES notation of 2-(2,6-Difluoro-4-nitrophenyl)propanoic acid? |
| A: SMILES notation of 2-(2,6-Difluoro-4-nitrophenyl)propanoic acid is CC(C(=O)O)c1c(F)cc([N+](=O)[O-])cc1F. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |