1,4-di-tert-butyl 2-(aminomethyl)piperazine-1,4-dicarboxylate
1,4-di-tert-butyl 2-(aminomethyl)piperazine-1,4-dicarboxylate structure
|
Common Name | 1,4-di-tert-butyl 2-(aminomethyl)piperazine-1,4-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 1256815-07-2 | Molecular Weight | 315.409 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 399.8±17.0 °C at 760 mmHg | |
| Molecular Formula | C15H29N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 195.6±20.9 °C | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Bis(2-methyl-2-propanyl) 2-(aminomethyl)-1,4-piperazinedicarboxylate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 399.8±17.0 °C at 760 mmHg |
| Molecular Formula | C15H29N3O4 |
| Molecular Weight | 315.409 |
| Flash Point | 195.6±20.9 °C |
| Exact Mass | 315.215820 |
| LogP | 0.99 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.492 |
| InChIKey | XJELTUFOFGNOTB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(C(=O)OC(C)(C)C)C(CN)C1 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1,4-Piperazinedicarboxylic acid, 2-(aminomethyl)-, bis(1,1-dimethylethyl) ester |
| Bis(2-methyl-2-propanyl) 2-(aminomethyl)-1,4-piperazinedicarboxylate |
| MFCD24471267 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of Bis(2-methyl-2-propanyl) 2-(aminomethyl)-1,4-piperazinedicarboxylate? |
| A: The English name of Bis(2-methyl-2-propanyl) 2-(aminomethyl)-1,4-piperazinedicarboxylate is Bis(2-methyl-2-propanyl) 2-(aminomethyl)-1,4-piperazinedicarboxylate. |
| Q: What is the LogP of Bis(2-methyl-2-propanyl) 2-(aminomethyl)-1,4-piperazinedicarboxylate? |
| A: LogP of Bis(2-methyl-2-propanyl) 2-(aminomethyl)-1,4-piperazinedicarboxylate is 0.99. |
| Q: What is the SMILES notation of Bis(2-methyl-2-propanyl) 2-(aminomethyl)-1,4-piperazinedicarboxylate? |
| A: SMILES notation of Bis(2-methyl-2-propanyl) 2-(aminomethyl)-1,4-piperazinedicarboxylate is CC(C)(C)OC(=O)N1CCN(C(=O)OC(C)(C)C)C(CN)C1. |
| Q: What is the molecular weight of Bis(2-methyl-2-propanyl) 2-(aminomethyl)-1,4-piperazinedicarboxylate? |
| A: Molecular weight of Bis(2-methyl-2-propanyl) 2-(aminomethyl)-1,4-piperazinedicarboxylate is 315.409. |
| Q: What English synonyms does Bis(2-methyl-2-propanyl) 2-(aminomethyl)-1,4-piperazinedicarboxylate have? |
| A: English synonyms of Bis(2-methyl-2-propanyl) 2-(aminomethyl)-1,4-piperazinedicarboxylate: 1,4-Piperazinedicarboxylic acid, 2-(aminomethyl)-, bis(1,1-dimethylethyl) ester, Bis(2-methyl-2-propanyl) 2-(aminomethyl)-1,4-piperazinedicarboxylate, MFCD24471267. |
| Q: What is the CAS number of Bis(2-methyl-2-propanyl) 2-(aminomethyl)-1,4-piperazinedicarboxylate? |
| A: CAS number of Bis(2-methyl-2-propanyl) 2-(aminomethyl)-1,4-piperazinedicarboxylate is 1256815-07-2. |
| Q: What is the InChIKey of Bis(2-methyl-2-propanyl) 2-(aminomethyl)-1,4-piperazinedicarboxylate? |
| A: InChIKey of Bis(2-methyl-2-propanyl) 2-(aminomethyl)-1,4-piperazinedicarboxylate is XJELTUFOFGNOTB-UHFFFAOYSA-N. |
| Q: What is the molecular formula of Bis(2-methyl-2-propanyl) 2-(aminomethyl)-1,4-piperazinedicarboxylate? |
| A: Molecular formula of Bis(2-methyl-2-propanyl) 2-(aminomethyl)-1,4-piperazinedicarboxylate is C15H29N3O4. |
| Q: What is the boiling point of Bis(2-methyl-2-propanyl) 2-(aminomethyl)-1,4-piperazinedicarboxylate? |
| A: Boiling point of Bis(2-methyl-2-propanyl) 2-(aminomethyl)-1,4-piperazinedicarboxylate is 399.8±17.0 °C at 760 mmHg. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |