2-(4-cyanophenyl)-2,2-difluoroacetic acid
2-(4-cyanophenyl)-2,2-difluoroacetic acid structure
|
Common Name | 2-(4-cyanophenyl)-2,2-difluoroacetic acid | ||
|---|---|---|---|---|
| CAS Number | 1261358-84-2 | Molecular Weight | 197.138 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 345.1±42.0 °C at 760 mmHg | |
| Molecular Formula | C9H5F2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 162.5±27.9 °C | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (4-Cyanophenyl)(difluoro)acetic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 345.1±42.0 °C at 760 mmHg |
| Molecular Formula | C9H5F2NO2 |
| Molecular Weight | 197.138 |
| Flash Point | 162.5±27.9 °C |
| Exact Mass | 197.028839 |
| LogP | 2.35 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.526 |
| InChIKey | YNJRLINCQPOYJK-UHFFFAOYSA-N |
| SMILES | N#Cc1ccc(C(F)(F)C(=O)O)cc1 |
| Storage condition | 2-8℃ |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| MFCD18533660 |
| (4-Cyanophenyl)(difluoro)acetic acid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of (4-Cyanophenyl)(difluoro)acetic acid? |
| A: The English name of (4-Cyanophenyl)(difluoro)acetic acid is (4-Cyanophenyl)(difluoro)acetic acid. |
| Q: What English synonyms does (4-Cyanophenyl)(difluoro)acetic acid have? |
| A: English synonyms of (4-Cyanophenyl)(difluoro)acetic acid: MFCD18533660, (4-Cyanophenyl)(difluoro)acetic acid. |
| Q: What is the CAS number of (4-Cyanophenyl)(difluoro)acetic acid? |
| A: CAS number of (4-Cyanophenyl)(difluoro)acetic acid is 1261358-84-2. |
| Q: What is the InChIKey of (4-Cyanophenyl)(difluoro)acetic acid? |
| A: InChIKey of (4-Cyanophenyl)(difluoro)acetic acid is YNJRLINCQPOYJK-UHFFFAOYSA-N. |
| Q: What is the molecular formula of (4-Cyanophenyl)(difluoro)acetic acid? |
| A: Molecular formula of (4-Cyanophenyl)(difluoro)acetic acid is C9H5F2NO2. |
| Q: What are the storage conditions for (4-Cyanophenyl)(difluoro)acetic acid? |
| A: Storage conditions for (4-Cyanophenyl)(difluoro)acetic acid: 2-8℃. |
| Q: What is the boiling point of (4-Cyanophenyl)(difluoro)acetic acid? |
| A: Boiling point of (4-Cyanophenyl)(difluoro)acetic acid is 345.1±42.0 °C at 760 mmHg. |
| Q: What is the molecular weight of (4-Cyanophenyl)(difluoro)acetic acid? |
| A: Molecular weight of (4-Cyanophenyl)(difluoro)acetic acid is 197.138. |
| Q: What is the LogP of (4-Cyanophenyl)(difluoro)acetic acid? |
| A: LogP of (4-Cyanophenyl)(difluoro)acetic acid is 2.35. |
| Q: What is the SMILES notation of (4-Cyanophenyl)(difluoro)acetic acid? |
| A: SMILES notation of (4-Cyanophenyl)(difluoro)acetic acid is N#Cc1ccc(C(F)(F)C(=O)O)cc1. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |