tert-butyl (4-azidobutyl)carbamate
tert-butyl (4-azidobutyl)carbamate structure
|
Common Name | tert-butyl (4-azidobutyl)carbamate | ||
|---|---|---|---|---|
| CAS Number | 129392-85-4 | Molecular Weight | 214.26500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H18N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: (4-azidobutyl)aminocarbonyl tert-butyl, Chinese name: (4-叠氮丁基)氨基甲酸叔丁酯, CAS number: 129392-85-4, molecular formula: C9H18N4O2, molecular weight: 214.26500. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | tert-butyl N-(4-azidobutyl)carbamate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H18N4O2 |
|---|---|
| Molecular Weight | 214.26500 |
| Exact Mass | 214.14300 |
| PSA | 91.57000 |
| LogP | 2.25876 |
| InChIKey | KIYMIEPOGRDHRF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCCCN=[N+]=[N-] |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 5 | |
|---|---|
| DownStream 3 | |
![4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl methanesulfonate Structure](https://image.chemsrc.com/caspic/281/174626-25-6.png)
CAS#:174626-25-6
CAS#:24424-99-5
CAS#:88192-20-5
CAS#:75178-87-9
CAS#:68076-36-8
CAS#:33545-98-1This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| N-t-butoxycarbonyl-4-azidobutylamine |
| 1-N-BOC-amino-butane-4-azide |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of tert-butyl N-(4-azidobutyl)carbamate? |
| A: Polar surface area (PSA) of tert-butyl N-(4-azidobutyl)carbamate is 91.57000. |
| Q: What is the English name of tert-butyl N-(4-azidobutyl)carbamate? |
| A: The English name of tert-butyl N-(4-azidobutyl)carbamate is tert-butyl N-(4-azidobutyl)carbamate. |
| Q: What English synonyms does tert-butyl N-(4-azidobutyl)carbamate have? |
| A: English synonyms of tert-butyl N-(4-azidobutyl)carbamate: N-t-butoxycarbonyl-4-azidobutylamine, 1-N-BOC-amino-butane-4-azide. |
| Q: What is the CAS number of tert-butyl N-(4-azidobutyl)carbamate? |
| A: CAS number of tert-butyl N-(4-azidobutyl)carbamate is 129392-85-4. |
| Q: What is the InChIKey of tert-butyl N-(4-azidobutyl)carbamate? |
| A: InChIKey of tert-butyl N-(4-azidobutyl)carbamate is KIYMIEPOGRDHRF-UHFFFAOYSA-N. |
| Q: What is the molecular formula of tert-butyl N-(4-azidobutyl)carbamate? |
| A: Molecular formula of tert-butyl N-(4-azidobutyl)carbamate is C9H18N4O2. |
| Q: What are the upstream materials of tert-butyl N-(4-azidobutyl)carbamate? |
| A: Related upstream materials(CAS) of tert-butyl N-(4-azidobutyl)carbamate: 174626-25-6;24424-99-5;88192-20-5;75178-87-9;68076-36-8. |
| Q: What are the downstream products of tert-butyl N-(4-azidobutyl)carbamate? |
| A: Related downstream products(CAS) of tert-butyl N-(4-azidobutyl)carbamate: 33545-98-1;68076-36-8;88192-20-5. |
| Q: What is the LogP of tert-butyl N-(4-azidobutyl)carbamate? |
| A: LogP of tert-butyl N-(4-azidobutyl)carbamate is 2.25876. |
| Q: What is the molecular weight of tert-butyl N-(4-azidobutyl)carbamate? |
| A: Molecular weight of tert-butyl N-(4-azidobutyl)carbamate is 214.26500. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |