2,6-Dichloro-5-fluoro-4-methylnicotinic acid
2,6-Dichloro-5-fluoro-4-methylnicotinic acid structure
|
Common Name | 2,6-Dichloro-5-fluoro-4-methylnicotinic acid | ||
|---|---|---|---|---|
| CAS Number | 132195-42-7 | Molecular Weight | 224.01700 | |
| Density | N/A | Boiling Point | 354.8±37.0°C at 760 mmHg | |
| Molecular Formula | C7H4Cl2FNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,6-Dichloro-5-fluoro-4-methylpyridine-3-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Boiling Point | 354.8±37.0°C at 760 mmHg |
|---|---|
| Molecular Formula | C7H4Cl2FNO2 |
| Molecular Weight | 224.01700 |
| Exact Mass | 222.96000 |
| PSA | 50.19000 |
| LogP | 2.53410 |
| InChIKey | CACZOIOUVVFGLV-UHFFFAOYSA-N |
| SMILES | Cc1c(F)c(Cl)nc(Cl)c1C(=O)O |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
CAS#:82671-06-5
CAS#:74-88-4This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2,6-dichloro-5-fluoro-4-methylnicotinic Acid |
| 2,6-dichloro-4-methyl-5-fluoronicotinic acid |
| 3-Pyridinecarboxylic acid,2,6-dichloro-5-fluoro-4-methyl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 2,6-Dichloro-5-fluoro-4-methylpyridine-3-carboxylic acid? |
| A: CAS number of 2,6-Dichloro-5-fluoro-4-methylpyridine-3-carboxylic acid is 132195-42-7. |
| Q: What is the molecular formula of 2,6-Dichloro-5-fluoro-4-methylpyridine-3-carboxylic acid? |
| A: Molecular formula of 2,6-Dichloro-5-fluoro-4-methylpyridine-3-carboxylic acid is C7H4Cl2FNO2. |
| Q: What is the polar surface area (PSA) of 2,6-Dichloro-5-fluoro-4-methylpyridine-3-carboxylic acid? |
| A: Polar surface area (PSA) of 2,6-Dichloro-5-fluoro-4-methylpyridine-3-carboxylic acid is 50.19000. |
| Q: What are the upstream materials of 2,6-Dichloro-5-fluoro-4-methylpyridine-3-carboxylic acid? |
| A: Related upstream materials(CAS) of 2,6-Dichloro-5-fluoro-4-methylpyridine-3-carboxylic acid: 82671-06-5;74-88-4. |
| Q: What is the InChIKey of 2,6-Dichloro-5-fluoro-4-methylpyridine-3-carboxylic acid? |
| A: InChIKey of 2,6-Dichloro-5-fluoro-4-methylpyridine-3-carboxylic acid is CACZOIOUVVFGLV-UHFFFAOYSA-N. |
| Q: What is the English name of 2,6-Dichloro-5-fluoro-4-methylpyridine-3-carboxylic acid? |
| A: The English name of 2,6-Dichloro-5-fluoro-4-methylpyridine-3-carboxylic acid is 2,6-Dichloro-5-fluoro-4-methylpyridine-3-carboxylic acid. |
| Q: What is the boiling point of 2,6-Dichloro-5-fluoro-4-methylpyridine-3-carboxylic acid? |
| A: Boiling point of 2,6-Dichloro-5-fluoro-4-methylpyridine-3-carboxylic acid is 354.8±37.0°C at 760 mmHg. |
| Q: What is the SMILES notation of 2,6-Dichloro-5-fluoro-4-methylpyridine-3-carboxylic acid? |
| A: SMILES notation of 2,6-Dichloro-5-fluoro-4-methylpyridine-3-carboxylic acid is Cc1c(F)c(Cl)nc(Cl)c1C(=O)O. |
| Q: What is the LogP of 2,6-Dichloro-5-fluoro-4-methylpyridine-3-carboxylic acid? |
| A: LogP of 2,6-Dichloro-5-fluoro-4-methylpyridine-3-carboxylic acid is 2.53410. |
| Q: What English synonyms does 2,6-Dichloro-5-fluoro-4-methylpyridine-3-carboxylic acid have? |
| A: English synonyms of 2,6-Dichloro-5-fluoro-4-methylpyridine-3-carboxylic acid: 2,6-dichloro-5-fluoro-4-methylnicotinic Acid, 2,6-dichloro-4-methyl-5-fluoronicotinic acid, 3-Pyridinecarboxylic acid,2,6-dichloro-5-fluoro-4-methyl. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |