2-(1H-indol-3-yl)-N-Methoxy-N-Methylacetamide
2-(1H-indol-3-yl)-N-Methoxy-N-Methylacetamide structure
|
Common Name | 2-(1H-indol-3-yl)-N-Methoxy-N-Methylacetamide | ||
|---|---|---|---|---|
| CAS Number | 132922-37-3 | Molecular Weight | 218.25200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H14N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(1H-indol-3-yl)-N-methoxy-N-methyl-acetamide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H14N2O2 |
|---|---|
| Molecular Weight | 218.25200 |
| Exact Mass | 218.10600 |
| PSA | 45.33000 |
| LogP | 1.73020 |
| InChIKey | AIHWIEBDIWCQCA-UHFFFAOYSA-N |
| SMILES | CON(C)C(=O)Cc1c[nH]c2ccccc12 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 3 | |
CAS#:1201-26-9
CAS#:2591-98-2![1,3-dimethyl-9H-pyrido[3,4-b]indole structure](https://image.chemsrc.com/caspic/494/22314-94-9.png)
CAS#:22314-94-9This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| .N-methoxy-N-methyl-2-(1H-indol-3-yl)acetamide |
| .N-methoxy N-methyl 2-(indol-3-yl)acetamide |
| .N-methoxy-N-methyl-1H-indole-3-acetamide |
| 2-(1H-indol-3-yl)-N-methoxy-N-methylacetamide |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 2-(1H-indol-3-yl)-N-methoxy-N-methyl-acetamide? |
| A: InChIKey of 2-(1H-indol-3-yl)-N-methoxy-N-methyl-acetamide is AIHWIEBDIWCQCA-UHFFFAOYSA-N. |
| Q: What is the CAS number of 2-(1H-indol-3-yl)-N-methoxy-N-methyl-acetamide? |
| A: CAS number of 2-(1H-indol-3-yl)-N-methoxy-N-methyl-acetamide is 132922-37-3. |
| Q: What is the LogP of 2-(1H-indol-3-yl)-N-methoxy-N-methyl-acetamide? |
| A: LogP of 2-(1H-indol-3-yl)-N-methoxy-N-methyl-acetamide is 1.73020. |
| Q: What English synonyms does 2-(1H-indol-3-yl)-N-methoxy-N-methyl-acetamide have? |
| A: English synonyms of 2-(1H-indol-3-yl)-N-methoxy-N-methyl-acetamide: .N-methoxy-N-methyl-2-(1H-indol-3-yl)acetamide, .N-methoxy N-methyl 2-(indol-3-yl)acetamide, .N-methoxy-N-methyl-1H-indole-3-acetamide, 2-(1H-indol-3-yl)-N-methoxy-N-methylacetamide. |
| Q: What is the English name of 2-(1H-indol-3-yl)-N-methoxy-N-methyl-acetamide? |
| A: The English name of 2-(1H-indol-3-yl)-N-methoxy-N-methyl-acetamide is 2-(1H-indol-3-yl)-N-methoxy-N-methyl-acetamide. |
| Q: What is the molecular weight of 2-(1H-indol-3-yl)-N-methoxy-N-methyl-acetamide? |
| A: Molecular weight of 2-(1H-indol-3-yl)-N-methoxy-N-methyl-acetamide is 218.25200. |
| Q: What are the downstream products of 2-(1H-indol-3-yl)-N-methoxy-N-methyl-acetamide? |
| A: Related downstream products(CAS) of 2-(1H-indol-3-yl)-N-methoxy-N-methyl-acetamide: 1201-26-9;2591-98-2;22314-94-9. |
| Q: What is the SMILES notation of 2-(1H-indol-3-yl)-N-methoxy-N-methyl-acetamide? |
| A: SMILES notation of 2-(1H-indol-3-yl)-N-methoxy-N-methyl-acetamide is CON(C)C(=O)Cc1c[nH]c2ccccc12. |
| Q: What is the polar surface area (PSA) of 2-(1H-indol-3-yl)-N-methoxy-N-methyl-acetamide? |
| A: Polar surface area (PSA) of 2-(1H-indol-3-yl)-N-methoxy-N-methyl-acetamide is 45.33000. |
| Q: What is the molecular formula of 2-(1H-indol-3-yl)-N-methoxy-N-methyl-acetamide? |
| A: Molecular formula of 2-(1H-indol-3-yl)-N-methoxy-N-methyl-acetamide is C12H14N2O2. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |