4-chloro-7-morpholinoquinazoline
4-chloro-7-morpholinoquinazoline structure
|
Common Name | 4-chloro-7-morpholinoquinazoline | ||
|---|---|---|---|---|
| CAS Number | 1334602-74-2 | Molecular Weight | 249.69600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H12ClN3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-(4-chloroquinazolin-7-yl)morpholine |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H12ClN3O |
|---|---|
| Molecular Weight | 249.69600 |
| Exact Mass | 249.06700 |
| PSA | 38.25000 |
| LogP | 2.18480 |
| InChIKey | GKFIGWQWNINBID-UHFFFAOYSA-N |
| SMILES | Clc1ncnc2cc(N3CCOCC3)ccc12 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4-chloro-7-morpholin-4-ylquinazoline |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 4-(4-chloroquinazolin-7-yl)morpholine? |
| A: The English name of 4-(4-chloroquinazolin-7-yl)morpholine is 4-(4-chloroquinazolin-7-yl)morpholine. |
| Q: What is the molecular weight of 4-(4-chloroquinazolin-7-yl)morpholine? |
| A: Molecular weight of 4-(4-chloroquinazolin-7-yl)morpholine is 249.69600. |
| Q: What is the polar surface area (PSA) of 4-(4-chloroquinazolin-7-yl)morpholine? |
| A: Polar surface area (PSA) of 4-(4-chloroquinazolin-7-yl)morpholine is 38.25000. |
| Q: What is the InChIKey of 4-(4-chloroquinazolin-7-yl)morpholine? |
| A: InChIKey of 4-(4-chloroquinazolin-7-yl)morpholine is GKFIGWQWNINBID-UHFFFAOYSA-N. |
| Q: What is the LogP of 4-(4-chloroquinazolin-7-yl)morpholine? |
| A: LogP of 4-(4-chloroquinazolin-7-yl)morpholine is 2.18480. |
| Q: What is the SMILES notation of 4-(4-chloroquinazolin-7-yl)morpholine? |
| A: SMILES notation of 4-(4-chloroquinazolin-7-yl)morpholine is Clc1ncnc2cc(N3CCOCC3)ccc12. |
| Q: What English synonyms does 4-(4-chloroquinazolin-7-yl)morpholine have? |
| A: English synonyms of 4-(4-chloroquinazolin-7-yl)morpholine: 4-chloro-7-morpholin-4-ylquinazoline. |
| Q: What is the molecular formula of 4-(4-chloroquinazolin-7-yl)morpholine? |
| A: Molecular formula of 4-(4-chloroquinazolin-7-yl)morpholine is C12H12ClN3O. |
| Q: What is the CAS number of 4-(4-chloroquinazolin-7-yl)morpholine? |
| A: CAS number of 4-(4-chloroquinazolin-7-yl)morpholine is 1334602-74-2. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |