benzyl (1S,5R)-6-(hydroxymethyl)-3-azabicyclo[3.1.0]hexane-3-carboxylate
![benzyl (1S,5R)-6-(hydroxymethyl)-3-azabicyclo[3.1.0]hexane-3-carboxylate Structure](https://image.chemsrc.com/caspic/173/134575-14-7.png)
benzyl (1S,5R)-6-(hydroxymethyl)-3-azabicyclo[3.1.0]hexane-3-carboxylate structure
|
Common Name | benzyl (1S,5R)-6-(hydroxymethyl)-3-azabicyclo[3.1.0]hexane-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 134575-14-7 | Molecular Weight | 247.29000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H17NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | benzyl (1S,5R)-6-(hydroxymethyl)-3-azabicyclo[3.1.0]hexane-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H17NO3 |
|---|---|
| Molecular Weight | 247.29000 |
| Exact Mass | 247.12100 |
| PSA | 49.77000 |
| LogP | 1.43120 |
| InChIKey | MLEVENZWZRZDLD-FUNVUKJBSA-N |
| SMILES | O=C(OCc1ccccc1)N1CC2C(CO)C2C1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 5 | |
|---|---|
| DownStream 2 | |
CAS#:501-53-1![exo-3-Cbz-3-azabicyclo[3.1.0]hexane-6-carboxylic acid Structure](https://image.chemsrc.com/caspic/135/134575-15-8.png)
CAS#:134575-15-8![((1R,5S,6R)-3-BENZYL-3-AZABICYCLO[3.1.0]HEXAN-6-YL)METHANOL Structure](https://image.chemsrc.com/caspic/266/134575-07-8.png)
CAS#:134575-07-8![(Meso-1R,5S,6R)-Ethyl 3-Benzyl-2,4-Dioxo-3-Azabicyclo[3.1.0]Hexane-6-Carboxylate Structure](https://image.chemsrc.com/caspic/304/134575-06-7.png)
CAS#:134575-06-7![[(1R,5S)-3-azabicyclo[3.1.0]hexan-6-yl]methanol Structure](https://image.chemsrc.com/caspic/211/134575-13-6.png)
CAS#:134575-13-6![tert-butyl 3-azabicyclo[3.1.0]hexan-6-ylcarbamate structure](https://image.chemsrc.com/caspic/049/134575-17-0.png)
CAS#:134575-17-0This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| BENZYL (1R,5S)-6-(HYDROXYMETHYL)-3-AZABICYCLO[3.1.0]HEXANE-3-CARBOXYLATE |
| Y7446 |
| exo-(1R,5S)-6-hydroxymethyl-3-aza-bicyclo[3.1.0]hexane-3-carboxylic acid benzyl ester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of benzyl (1S,5R)-6-(hydroxymethyl)-3-azabicyclo[3.1.0]hexane-3-carboxylate? |
| A: InChIKey of benzyl (1S,5R)-6-(hydroxymethyl)-3-azabicyclo[3.1.0]hexane-3-carboxylate is MLEVENZWZRZDLD-FUNVUKJBSA-N. |
| Q: What are the upstream materials of benzyl (1S,5R)-6-(hydroxymethyl)-3-azabicyclo[3.1.0]hexane-3-carboxylate? |
| A: Related upstream materials(CAS) of benzyl (1S,5R)-6-(hydroxymethyl)-3-azabicyclo[3.1.0]hexane-3-carboxylate: 501-53-1;134575-15-8;134575-07-8;134575-06-7;134575-13-6. |
| Q: What is the CAS number of benzyl (1S,5R)-6-(hydroxymethyl)-3-azabicyclo[3.1.0]hexane-3-carboxylate? |
| A: CAS number of benzyl (1S,5R)-6-(hydroxymethyl)-3-azabicyclo[3.1.0]hexane-3-carboxylate is 134575-14-7. |
| Q: What is the SMILES notation of benzyl (1S,5R)-6-(hydroxymethyl)-3-azabicyclo[3.1.0]hexane-3-carboxylate? |
| A: SMILES notation of benzyl (1S,5R)-6-(hydroxymethyl)-3-azabicyclo[3.1.0]hexane-3-carboxylate is O=C(OCc1ccccc1)N1CC2C(CO)C2C1. |
| Q: What is the molecular weight of benzyl (1S,5R)-6-(hydroxymethyl)-3-azabicyclo[3.1.0]hexane-3-carboxylate? |
| A: Molecular weight of benzyl (1S,5R)-6-(hydroxymethyl)-3-azabicyclo[3.1.0]hexane-3-carboxylate is 247.29000. |
| Q: What are the downstream products of benzyl (1S,5R)-6-(hydroxymethyl)-3-azabicyclo[3.1.0]hexane-3-carboxylate? |
| A: Related downstream products(CAS) of benzyl (1S,5R)-6-(hydroxymethyl)-3-azabicyclo[3.1.0]hexane-3-carboxylate: 134575-17-0;134575-15-8. |
| Q: What English synonyms does benzyl (1S,5R)-6-(hydroxymethyl)-3-azabicyclo[3.1.0]hexane-3-carboxylate have? |
| A: English synonyms of benzyl (1S,5R)-6-(hydroxymethyl)-3-azabicyclo[3.1.0]hexane-3-carboxylate: BENZYL (1R,5S)-6-(HYDROXYMETHYL)-3-AZABICYCLO[3.1.0]HEXANE-3-CARBOXYLATE, Y7446, exo-(1R,5S)-6-hydroxymethyl-3-aza-bicyclo[3.1.0]hexane-3-carboxylic acid benzyl ester. |
| Q: What is the English name of benzyl (1S,5R)-6-(hydroxymethyl)-3-azabicyclo[3.1.0]hexane-3-carboxylate? |
| A: The English name of benzyl (1S,5R)-6-(hydroxymethyl)-3-azabicyclo[3.1.0]hexane-3-carboxylate is benzyl (1S,5R)-6-(hydroxymethyl)-3-azabicyclo[3.1.0]hexane-3-carboxylate. |
| Q: What is the LogP of benzyl (1S,5R)-6-(hydroxymethyl)-3-azabicyclo[3.1.0]hexane-3-carboxylate? |
| A: LogP of benzyl (1S,5R)-6-(hydroxymethyl)-3-azabicyclo[3.1.0]hexane-3-carboxylate is 1.43120. |
| Q: What is the polar surface area (PSA) of benzyl (1S,5R)-6-(hydroxymethyl)-3-azabicyclo[3.1.0]hexane-3-carboxylate? |
| A: Polar surface area (PSA) of benzyl (1S,5R)-6-(hydroxymethyl)-3-azabicyclo[3.1.0]hexane-3-carboxylate is 49.77000. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |