7-Bromo-2-ethyl-1H-benzo[d]imidazole-5-carboxylic acid structure
|
Common Name | 7-Bromo-2-ethyl-1H-benzo[d]imidazole-5-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 1378260-23-1 | Molecular Weight | 269.095 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 533.4±35.0 °C at 760 mmHg | |
| Molecular Formula | C10H9BrN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 276.4±25.9 °C | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 7-Bromo-2-ethyl-1H-benzo[d]imidazole-5-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 533.4±35.0 °C at 760 mmHg |
| Molecular Formula | C10H9BrN2O2 |
| Molecular Weight | 269.095 |
| Flash Point | 276.4±25.9 °C |
| Exact Mass | 267.984741 |
| LogP | 2.30 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.704 |
| InChIKey | OXCZOTDCDAMDRC-UHFFFAOYSA-N |
| SMILES | CCc1nc2c(Br)cc(C(=O)O)cc2[nH]1 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 7-Bromo-2-ethyl-1H-benzimidazole-5-carboxylic acid |
| MFCD22371619 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 7-Bromo-2-ethyl-1H-benzo[d]imidazole-5-carboxylic acid? |
| A: CAS number of 7-Bromo-2-ethyl-1H-benzo[d]imidazole-5-carboxylic acid is 1378260-23-1. |
| Q: What is the LogP of 7-Bromo-2-ethyl-1H-benzo[d]imidazole-5-carboxylic acid? |
| A: LogP of 7-Bromo-2-ethyl-1H-benzo[d]imidazole-5-carboxylic acid is 2.30. |
| Q: What is the molecular formula of 7-Bromo-2-ethyl-1H-benzo[d]imidazole-5-carboxylic acid? |
| A: Molecular formula of 7-Bromo-2-ethyl-1H-benzo[d]imidazole-5-carboxylic acid is C10H9BrN2O2. |
| Q: What is the SMILES notation of 7-Bromo-2-ethyl-1H-benzo[d]imidazole-5-carboxylic acid? |
| A: SMILES notation of 7-Bromo-2-ethyl-1H-benzo[d]imidazole-5-carboxylic acid is CCc1nc2c(Br)cc(C(=O)O)cc2[nH]1. |
| Q: What is the InChIKey of 7-Bromo-2-ethyl-1H-benzo[d]imidazole-5-carboxylic acid? |
| A: InChIKey of 7-Bromo-2-ethyl-1H-benzo[d]imidazole-5-carboxylic acid is OXCZOTDCDAMDRC-UHFFFAOYSA-N. |
| Q: What is the boiling point of 7-Bromo-2-ethyl-1H-benzo[d]imidazole-5-carboxylic acid? |
| A: Boiling point of 7-Bromo-2-ethyl-1H-benzo[d]imidazole-5-carboxylic acid is 533.4±35.0 °C at 760 mmHg. |
| Q: What English synonyms does 7-Bromo-2-ethyl-1H-benzo[d]imidazole-5-carboxylic acid have? |
| A: English synonyms of 7-Bromo-2-ethyl-1H-benzo[d]imidazole-5-carboxylic acid: 7-Bromo-2-ethyl-1H-benzimidazole-5-carboxylic acid, MFCD22371619. |
| Q: What is the molecular weight of 7-Bromo-2-ethyl-1H-benzo[d]imidazole-5-carboxylic acid? |
| A: Molecular weight of 7-Bromo-2-ethyl-1H-benzo[d]imidazole-5-carboxylic acid is 269.095. |
| Q: What is the English name of 7-Bromo-2-ethyl-1H-benzo[d]imidazole-5-carboxylic acid? |
| A: The English name of 7-Bromo-2-ethyl-1H-benzo[d]imidazole-5-carboxylic acid is 7-Bromo-2-ethyl-1H-benzo[d]imidazole-5-carboxylic acid. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |