3-tert-Butoxycarbonylamino-5-methyl-hexanoic acid
3-tert-Butoxycarbonylamino-5-methyl-hexanoic acid structure
|
Common Name | 3-tert-Butoxycarbonylamino-5-methyl-hexanoic acid | ||
|---|---|---|---|---|
| CAS Number | 138165-75-0 | Molecular Weight | 245.315 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 374.3±25.0 °C at 760 mmHg | |
| Molecular Formula | C12H23NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 180.2±23.2 °C | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 374.3±25.0 °C at 760 mmHg |
| Molecular Formula | C12H23NO4 |
| Molecular Weight | 245.315 |
| Flash Point | 180.2±23.2 °C |
| Exact Mass | 245.162704 |
| PSA | 79.12000 |
| LogP | 2.68 |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |
| Index of Refraction | 1.462 |
| InChIKey | XRVAMBSTOWHUMM-UHFFFAOYSA-N |
| SMILES | CC(C)CC(CC(=O)O)NC(=O)OC(C)(C)C |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2924199090 |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 9 | |
|---|---|
| DownStream 0 | |
![[(1S,3R,4R)-3,4-dihydroxy-1-isobutyl-pentyl]-carbamic acid tert-butyl ester Structure](https://image.chemsrc.com/caspic/220/557091-72-2.png)
CAS#:557091-72-2
CAS#:748793-66-0![benzyl ((S)-5-methyl-1-oxo-1-((1R,2R,4R)-1,7,7-trimethyl-2-((trimethylsilyl)oxy)bicyclo[2.2.1]heptan-2-yl)hexan-3-yl)carbamate Structure](https://image.chemsrc.com/caspic/168/271600-17-0.png)
CAS#:271600-17-0![(1R)-1-[(5R)-3-isobutyl-4,5-dihydro-isoxazol-5-yl]-ethanol Structure](https://image.chemsrc.com/caspic/199/557091-68-6.png)
CAS#:557091-68-6
CAS#:4248-19-5
CAS#:748793-55-7
CAS#:5775-74-6
CAS#:41542-31-8
CAS#:118247-68-0This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3-[(t-butoxycarbonyl)amino]-5-methylhexanoicacid |
| 5-Methyl-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)hexanoic acid |
| 3-boc-amino-5-methyl-hexanoic acid |
| 3-tert-Butoxycarbonylamino-5-methyl-hexanoic acid |
| 3-[(tert-Butoxycarbonyl)amino]-5-methylhexanoic acid |
| tmba014 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 5-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid? |
| A: LogP of 5-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid is 2.68. |
| Q: What is the InChIKey of 5-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid? |
| A: InChIKey of 5-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid is XRVAMBSTOWHUMM-UHFFFAOYSA-N. |
| Q: What is the CAS number of 5-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid? |
| A: CAS number of 5-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid is 138165-75-0. |
| Q: What are the upstream materials of 5-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid? |
| A: Related upstream materials(CAS) of 5-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid: 557091-72-2;748793-66-0;271600-17-0;557091-68-6;4248-19-5;748793-55-7;5775-74-6;41542-31-8;118247-68-0. |
| Q: What is the SMILES notation of 5-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid? |
| A: SMILES notation of 5-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid is CC(C)CC(CC(=O)O)NC(=O)OC(C)(C)C. |
| Q: What English synonyms does 5-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid have? |
| A: English synonyms of 5-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid: 3-[(t-butoxycarbonyl)amino]-5-methylhexanoicacid, 5-Methyl-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)hexanoic acid, 3-boc-amino-5-methyl-hexanoic acid, 3-tert-Butoxycarbonylamino-5-methyl-hexanoic acid, 3-[(tert-Butoxycarbonyl)amino]-5-methylhexanoic acid, tmba014. |
| Q: What is the English name of 5-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid? |
| A: The English name of 5-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid is 5-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid. |
| Q: What is the molecular weight of 5-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid? |
| A: Molecular weight of 5-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid is 245.315. |
| Q: What is the polar surface area (PSA) of 5-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid? |
| A: Polar surface area (PSA) of 5-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid is 79.12000. |
| Q: What is the boiling point of 5-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid? |
| A: Boiling point of 5-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid is 374.3±25.0 °C at 760 mmHg. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |