5-methoxy-1-(4-methylbenzenesulfonyl)-1H-indole
5-methoxy-1-(4-methylbenzenesulfonyl)-1H-indole structure
|
Common Name | 5-methoxy-1-(4-methylbenzenesulfonyl)-1H-indole | ||
|---|---|---|---|---|
| CAS Number | 139717-71-8 | Molecular Weight | 301.36000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H15NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-methoxy-1-(4-methylphenyl)sulfonylindole |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H15NO3S |
|---|---|
| Molecular Weight | 301.36000 |
| Exact Mass | 301.07700 |
| PSA | 56.68000 |
| LogP | 4.27610 |
| InChIKey | SWJXHHMYYCPWLX-UHFFFAOYSA-N |
| SMILES | COc1ccc2c(ccn2S(=O)(=O)c2ccc(C)cc2)c1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 5 | |
|---|---|
| DownStream 1 | |
CAS#:1150-26-1
CAS#:1822-73-7
CAS#:1006-94-6
CAS#:98-59-9
CAS#:104-94-9This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 5-methoxy-1-tosylindole |
| N-tosyl-5-methoxyindole |
| 1H-Indole,5-methoxy-1-[(4-methylphenyl)sulfonyl] |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of 5-methoxy-1-(4-methylphenyl)sulfonylindole? |
| A: Polar surface area (PSA) of 5-methoxy-1-(4-methylphenyl)sulfonylindole is 56.68000. |
| Q: What is the SMILES notation of 5-methoxy-1-(4-methylphenyl)sulfonylindole? |
| A: SMILES notation of 5-methoxy-1-(4-methylphenyl)sulfonylindole is COc1ccc2c(ccn2S(=O)(=O)c2ccc(C)cc2)c1. |
| Q: What is the LogP of 5-methoxy-1-(4-methylphenyl)sulfonylindole? |
| A: LogP of 5-methoxy-1-(4-methylphenyl)sulfonylindole is 4.27610. |
| Q: What is the English name of 5-methoxy-1-(4-methylphenyl)sulfonylindole? |
| A: The English name of 5-methoxy-1-(4-methylphenyl)sulfonylindole is 5-methoxy-1-(4-methylphenyl)sulfonylindole. |
| Q: What is the molecular formula of 5-methoxy-1-(4-methylphenyl)sulfonylindole? |
| A: Molecular formula of 5-methoxy-1-(4-methylphenyl)sulfonylindole is C16H15NO3S. |
| Q: What is the CAS number of 5-methoxy-1-(4-methylphenyl)sulfonylindole? |
| A: CAS number of 5-methoxy-1-(4-methylphenyl)sulfonylindole is 139717-71-8. |
| Q: What is the molecular weight of 5-methoxy-1-(4-methylphenyl)sulfonylindole? |
| A: Molecular weight of 5-methoxy-1-(4-methylphenyl)sulfonylindole is 301.36000. |
| Q: What English synonyms does 5-methoxy-1-(4-methylphenyl)sulfonylindole have? |
| A: English synonyms of 5-methoxy-1-(4-methylphenyl)sulfonylindole: 5-methoxy-1-tosylindole, N-tosyl-5-methoxyindole, 1H-Indole,5-methoxy-1-[(4-methylphenyl)sulfonyl]. |
| Q: What is the InChIKey of 5-methoxy-1-(4-methylphenyl)sulfonylindole? |
| A: InChIKey of 5-methoxy-1-(4-methylphenyl)sulfonylindole is SWJXHHMYYCPWLX-UHFFFAOYSA-N. |
| Q: What are the downstream products of 5-methoxy-1-(4-methylphenyl)sulfonylindole? |
| A: Related downstream products(CAS) of 5-methoxy-1-(4-methylphenyl)sulfonylindole: 1006-94-6. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |