9,10-dimethylanthracene-2,3,6,7-tetraol
9,10-dimethylanthracene-2,3,6,7-tetraol structure
|
Common Name | 9,10-dimethylanthracene-2,3,6,7-tetraol | ||
|---|---|---|---|---|
| CAS Number | 13979-56-1 | Molecular Weight | 270.28000 | |
| Density | 1.469±0.06 g/cm3(Predicted) | Boiling Point | 586.5±45.0 °C(Predicted) | |
| Molecular Formula | C16H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,3,6,7-tetrahydroxy-9,10-dimethyl-anthracene |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.469±0.06 g/cm3(Predicted) |
|---|---|
| Boiling Point | 586.5±45.0 °C(Predicted) |
| Molecular Formula | C16H14O4 |
| Molecular Weight | 270.28000 |
| Exact Mass | 270.08900 |
| PSA | 80.92000 |
| LogP | 3.43220 |
| InChIKey | LSRBZTZFDKGLOB-UHFFFAOYSA-N |
| SMILES | Cc1c2cc(O)c(O)cc2c(C)c2cc(O)c(O)cc12 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:13979-57-2This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2,3,6,7-Tetrahydroxy-9,10-dimethylanthracen |
| 9,10-dimethyl-2,3,6,7-tetrahydroxyanthracene |
| 2,3,6,7-tetrahydroxy-9,10-dimethylanthracene |
| THDMA |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 2,3,6,7-tetrahydroxy-9,10-dimethyl-anthracene? |
| A: The English name of 2,3,6,7-tetrahydroxy-9,10-dimethyl-anthracene is 2,3,6,7-tetrahydroxy-9,10-dimethyl-anthracene. |
| Q: What is the SMILES notation of 2,3,6,7-tetrahydroxy-9,10-dimethyl-anthracene? |
| A: SMILES notation of 2,3,6,7-tetrahydroxy-9,10-dimethyl-anthracene is Cc1c2cc(O)c(O)cc2c(C)c2cc(O)c(O)cc12. |
| Q: What is the boiling point of 2,3,6,7-tetrahydroxy-9,10-dimethyl-anthracene? |
| A: Boiling point of 2,3,6,7-tetrahydroxy-9,10-dimethyl-anthracene is 586.5±45.0 °C(Predicted). |
| Q: What is the LogP of 2,3,6,7-tetrahydroxy-9,10-dimethyl-anthracene? |
| A: LogP of 2,3,6,7-tetrahydroxy-9,10-dimethyl-anthracene is 3.43220. |
| Q: What English synonyms does 2,3,6,7-tetrahydroxy-9,10-dimethyl-anthracene have? |
| A: English synonyms of 2,3,6,7-tetrahydroxy-9,10-dimethyl-anthracene: 2,3,6,7-Tetrahydroxy-9,10-dimethylanthracen, 9,10-dimethyl-2,3,6,7-tetrahydroxyanthracene, 2,3,6,7-tetrahydroxy-9,10-dimethylanthracene, THDMA. |
| Q: What is the InChIKey of 2,3,6,7-tetrahydroxy-9,10-dimethyl-anthracene? |
| A: InChIKey of 2,3,6,7-tetrahydroxy-9,10-dimethyl-anthracene is LSRBZTZFDKGLOB-UHFFFAOYSA-N. |
| Q: What are the downstream products of 2,3,6,7-tetrahydroxy-9,10-dimethyl-anthracene? |
| A: Related downstream products(CAS) of 2,3,6,7-tetrahydroxy-9,10-dimethyl-anthracene: 13979-57-2. |
| Q: What is the polar surface area (PSA) of 2,3,6,7-tetrahydroxy-9,10-dimethyl-anthracene? |
| A: Polar surface area (PSA) of 2,3,6,7-tetrahydroxy-9,10-dimethyl-anthracene is 80.92000. |
| Q: What is the CAS number of 2,3,6,7-tetrahydroxy-9,10-dimethyl-anthracene? |
| A: CAS number of 2,3,6,7-tetrahydroxy-9,10-dimethyl-anthracene is 13979-56-1. |
| Q: What is the molecular weight of 2,3,6,7-tetrahydroxy-9,10-dimethyl-anthracene? |
| A: Molecular weight of 2,3,6,7-tetrahydroxy-9,10-dimethyl-anthracene is 270.28000. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |