1-(4-Hydroxy-[1,1'-biphenyl]-3-yl)ethan-1-one
![1-(4-Hydroxy-[1,1'-biphenyl]-3-yl)ethan-1-one Structure](https://image.chemsrc.com/caspic/427/14031-80-2.png)
1-(4-Hydroxy-[1,1'-biphenyl]-3-yl)ethan-1-one structure
|
Common Name | 1-(4-Hydroxy-[1,1'-biphenyl]-3-yl)ethan-1-one | ||
|---|---|---|---|---|
| CAS Number | 14031-80-2 | Molecular Weight | 212.24 | |
| Density | 1.149±0.06 g/cm3(Predicted) | Boiling Point | 361.4±30.0 °C(Predicted) | |
| Molecular Formula | C14H12O2 | Melting Point | 61.5–62°C | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(4-Hydroxy-[1,1'-biphenyl]-3-yl)ethan-1-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.149±0.06 g/cm3(Predicted) |
|---|---|
| Boiling Point | 361.4±30.0 °C(Predicted) |
| Melting Point | 61.5–62°C |
| Molecular Formula | C14H12O2 |
| Molecular Weight | 212.24 |
| InChIKey | UJPXBWSJJVPTTJ-UHFFFAOYSA-N |
| SMILES | CC(=O)c1cc(-c2ccccc2)ccc1O |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| MFCD06802890 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does 1-(4-Hydroxy-[1,1'-biphenyl]-3-yl)ethan-1-one have? |
| A: English synonyms of 1-(4-Hydroxy-[1,1'-biphenyl]-3-yl)ethan-1-one: MFCD06802890. |
| Q: What is the CAS number of 1-(4-Hydroxy-[1,1'-biphenyl]-3-yl)ethan-1-one? |
| A: CAS number of 1-(4-Hydroxy-[1,1'-biphenyl]-3-yl)ethan-1-one is 14031-80-2. |
| Q: What is the InChIKey of 1-(4-Hydroxy-[1,1'-biphenyl]-3-yl)ethan-1-one? |
| A: InChIKey of 1-(4-Hydroxy-[1,1'-biphenyl]-3-yl)ethan-1-one is UJPXBWSJJVPTTJ-UHFFFAOYSA-N. |
| Q: What is the boiling point of 1-(4-Hydroxy-[1,1'-biphenyl]-3-yl)ethan-1-one? |
| A: Boiling point of 1-(4-Hydroxy-[1,1'-biphenyl]-3-yl)ethan-1-one is 361.4±30.0 °C(Predicted). |
| Q: What is the English name of 1-(4-Hydroxy-[1,1'-biphenyl]-3-yl)ethan-1-one? |
| A: The English name of 1-(4-Hydroxy-[1,1'-biphenyl]-3-yl)ethan-1-one is 1-(4-Hydroxy-[1,1'-biphenyl]-3-yl)ethan-1-one. |
| Q: What is the molecular formula of 1-(4-Hydroxy-[1,1'-biphenyl]-3-yl)ethan-1-one? |
| A: Molecular formula of 1-(4-Hydroxy-[1,1'-biphenyl]-3-yl)ethan-1-one is C14H12O2. |
| Q: What is the molecular weight of 1-(4-Hydroxy-[1,1'-biphenyl]-3-yl)ethan-1-one? |
| A: Molecular weight of 1-(4-Hydroxy-[1,1'-biphenyl]-3-yl)ethan-1-one is 212.24. |
| Q: What is the SMILES notation of 1-(4-Hydroxy-[1,1'-biphenyl]-3-yl)ethan-1-one? |
| A: SMILES notation of 1-(4-Hydroxy-[1,1'-biphenyl]-3-yl)ethan-1-one is CC(=O)c1cc(-c2ccccc2)ccc1O. |
| Q: What is the melting point of 1-(4-Hydroxy-[1,1'-biphenyl]-3-yl)ethan-1-one? |
| A: Melting point of 1-(4-Hydroxy-[1,1'-biphenyl]-3-yl)ethan-1-one is 61.5–62°C. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |