tert-Butyl 6-aminopicolinate
tert-Butyl 6-aminopicolinate structure
|
Common Name | tert-Butyl 6-aminopicolinate | ||
|---|---|---|---|---|
| CAS Number | 1499890-31-1 | Molecular Weight | 194.23 | |
| Density | 1.126±0.06 g/cm3(Predicted) | Boiling Point | 336.5±22.0 °C(Predicted) | |
| Molecular Formula | C10H14N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 157.3±22.3 °C | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | tert-butyl 6-aminopyridine-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.126±0.06 g/cm3(Predicted) |
|---|---|
| Boiling Point | 336.5±22.0 °C(Predicted) |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 |
| Flash Point | 157.3±22.3 °C |
| Exact Mass | 194.105530 |
| LogP | 1.72 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.542 |
| InChIKey | DGWJAKGLKLCRFA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)c1cccc(N)n1 |
| Storage condition | Keep in dark place,Sealed in dry,Room Temperature |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-Methyl-2-propanyl 6-amino-2-pyridinecarboxylate |
| MFCD24127898 |
| 2-Pyridinecarboxylic acid, 6-amino-, 1,1-dimethylethyl ester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does tert-butyl 6-aminopyridine-2-carboxylate have? |
| A: English synonyms of tert-butyl 6-aminopyridine-2-carboxylate: 2-Methyl-2-propanyl 6-amino-2-pyridinecarboxylate, MFCD24127898, 2-Pyridinecarboxylic acid, 6-amino-, 1,1-dimethylethyl ester. |
| Q: What is the molecular weight of tert-butyl 6-aminopyridine-2-carboxylate? |
| A: Molecular weight of tert-butyl 6-aminopyridine-2-carboxylate is 194.23. |
| Q: What is the LogP of tert-butyl 6-aminopyridine-2-carboxylate? |
| A: LogP of tert-butyl 6-aminopyridine-2-carboxylate is 1.72. |
| Q: What is the boiling point of tert-butyl 6-aminopyridine-2-carboxylate? |
| A: Boiling point of tert-butyl 6-aminopyridine-2-carboxylate is 336.5±22.0 °C(Predicted). |
| Q: What is the CAS number of tert-butyl 6-aminopyridine-2-carboxylate? |
| A: CAS number of tert-butyl 6-aminopyridine-2-carboxylate is 1499890-31-1. |
| Q: What are the storage conditions for tert-butyl 6-aminopyridine-2-carboxylate? |
| A: Storage conditions for tert-butyl 6-aminopyridine-2-carboxylate: Keep in dark place,Sealed in dry,Room Temperature. |
| Q: What is the InChIKey of tert-butyl 6-aminopyridine-2-carboxylate? |
| A: InChIKey of tert-butyl 6-aminopyridine-2-carboxylate is DGWJAKGLKLCRFA-UHFFFAOYSA-N. |
| Q: What is the English name of tert-butyl 6-aminopyridine-2-carboxylate? |
| A: The English name of tert-butyl 6-aminopyridine-2-carboxylate is tert-butyl 6-aminopyridine-2-carboxylate. |
| Q: What is the molecular formula of tert-butyl 6-aminopyridine-2-carboxylate? |
| A: Molecular formula of tert-butyl 6-aminopyridine-2-carboxylate is C10H14N2O2. |
| Q: What is the SMILES notation of tert-butyl 6-aminopyridine-2-carboxylate? |
| A: SMILES notation of tert-butyl 6-aminopyridine-2-carboxylate is CC(C)(C)OC(=O)c1cccc(N)n1. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |