(S)-tert-Butyl (1-([1,1'-biphenyl]-4-yl)-3-hydroxypropan-2-yl)carbamate
![(S)-tert-Butyl (1-([1,1'-biphenyl]-4-yl)-3-hydroxypropan-2-yl)carbamate Structure](https://image.chemsrc.com/caspic/441/153037-40-2.png)
(S)-tert-Butyl (1-([1,1'-biphenyl]-4-yl)-3-hydroxypropan-2-yl)carbamate structure
|
Common Name | (S)-tert-Butyl (1-([1,1'-biphenyl]-4-yl)-3-hydroxypropan-2-yl)carbamate | ||
|---|---|---|---|---|
| CAS Number | 153037-40-2 | Molecular Weight | 327.417 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 514.5±50.0 °C at 760 mmHg | |
| Molecular Formula | C20H25NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 265.0±30.1 °C | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1426129-50-1 enantioMer |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 514.5±50.0 °C at 760 mmHg |
| Molecular Formula | C20H25NO3 |
| Molecular Weight | 327.417 |
| Flash Point | 265.0±30.1 °C |
| Exact Mass | 327.183441 |
| LogP | 4.40 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.553 |
| InChIKey | TYQICOFAZDVKMK-SFHVURJKSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CO)Cc1ccc(-c2ccccc2)cc1 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Carbamic acid, N-[(1S)-2-[1,1'-biphenyl]-4-yl-1-(hydroxymethyl)ethyl]-, 1,1-dimethylethyl ester |
| 2-Methyl-2-propanyl [(2S)-1-(4-biphenylyl)-3-hydroxy-2-propanyl]carbamate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 1426129-50-1 enantioMer? |
| A: Molecular formula of 1426129-50-1 enantioMer is C20H25NO3. |
| Q: What is the LogP of 1426129-50-1 enantioMer? |
| A: LogP of 1426129-50-1 enantioMer is 4.40. |
| Q: What is the molecular weight of 1426129-50-1 enantioMer? |
| A: Molecular weight of 1426129-50-1 enantioMer is 327.417. |
| Q: What is the SMILES notation of 1426129-50-1 enantioMer? |
| A: SMILES notation of 1426129-50-1 enantioMer is CC(C)(C)OC(=O)NC(CO)Cc1ccc(-c2ccccc2)cc1. |
| Q: What is the InChIKey of 1426129-50-1 enantioMer? |
| A: InChIKey of 1426129-50-1 enantioMer is TYQICOFAZDVKMK-SFHVURJKSA-N. |
| Q: What is the boiling point of 1426129-50-1 enantioMer? |
| A: Boiling point of 1426129-50-1 enantioMer is 514.5±50.0 °C at 760 mmHg. |
| Q: What is the CAS number of 1426129-50-1 enantioMer? |
| A: CAS number of 1426129-50-1 enantioMer is 153037-40-2. |
| Q: What is the English name of 1426129-50-1 enantioMer? |
| A: The English name of 1426129-50-1 enantioMer is 1426129-50-1 enantioMer. |
| Q: What English synonyms does 1426129-50-1 enantioMer have? |
| A: English synonyms of 1426129-50-1 enantioMer: Carbamic acid, N-[(1S)-2-[1,1'-biphenyl]-4-yl-1-(hydroxymethyl)ethyl]-, 1,1-dimethylethyl ester, 2-Methyl-2-propanyl [(2S)-1-(4-biphenylyl)-3-hydroxy-2-propanyl]carbamate. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |