Diethyl naphthalene-2,6-dicarboxylate
Diethyl naphthalene-2,6-dicarboxylate structure
|
Common Name | Diethyl naphthalene-2,6-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 15442-73-6 | Molecular Weight | 272.29 | |
| Density | 1.172g/cm3 | Boiling Point | 400.323ºC at 760 mmHg | |
| Molecular Formula | C16H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 199.726ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Diethyl-2,6-naphthalenedicarboxylate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.172g/cm3 |
|---|---|
| Boiling Point | 400.323ºC at 760 mmHg |
| Molecular Formula | C16H16O4 |
| Molecular Weight | 272.29 |
| Flash Point | 199.726ºC |
| Exact Mass | 272.10485899 |
| PSA | 80.26000 |
| LogP | 0.69160 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.576 |
| InChIKey | CSNCOKSAYUDNIE-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(C=C1)C=C(C=C2)C(=O)OCC |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2917399090 |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~94%
Diethyl naphtha... CAS#:15442-73-6 |
| Literature: Xiao, Ze-Yun; Zhao, Xin; Jiang, Xi-Kui; Li, Zhan-Ting Organic and Biomolecular Chemistry, 2009 , vol. 7, # 12 p. 2540 - 2547 |
|
~25%
Diethyl naphtha... CAS#:15442-73-6 |
| Literature: Strey, Karsten; Voes, Juergen Journal of Chemical Research, Miniprint, 1998 , # 3 p. 648 - 682 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 0 | |
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| pyridine-2,6-dicarboxylic acid diethyl ester |
| diethyl-2,6-pyridinedicarbonyl ester |
| 2,6-pyridine dicarboxylic ethyl ester |
| diethyl 2,6-naphthalenedicarboxylate |
| Naphthalin-2,6-dicarbonsaeure-diaethylester |
| 2,6-diethyl pyridine-2,6-dicarboxylate |
| diethyl 2,6-dipicolinate |
| diethyl naphthalene-2,6-dicarboxylate |
| diethylpyridin-2,6-dicarboxylat |
| pyridine-2,6-dicarboxylic acid ethyl ester |
| 2,6-pyridinedicarboxylic acid diethyl ester |
| Diethyl Dipicolinate |
| 2,6-pyridinecarboxylic acid diethyl ester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of Diethyl-2,6-naphthalenedicarboxylate? |
| A: Molecular formula of Diethyl-2,6-naphthalenedicarboxylate is C16H16O4. |
| Q: What is the boiling point of Diethyl-2,6-naphthalenedicarboxylate? |
| A: Boiling point of Diethyl-2,6-naphthalenedicarboxylate is 400.323ºC at 760 mmHg. |
| Q: What is the English name of Diethyl-2,6-naphthalenedicarboxylate? |
| A: The English name of Diethyl-2,6-naphthalenedicarboxylate is Diethyl-2,6-naphthalenedicarboxylate. |
| Q: What is the polar surface area (PSA) of Diethyl-2,6-naphthalenedicarboxylate? |
| A: Polar surface area (PSA) of Diethyl-2,6-naphthalenedicarboxylate is 80.26000. |
| Q: What is the InChIKey of Diethyl-2,6-naphthalenedicarboxylate? |
| A: InChIKey of Diethyl-2,6-naphthalenedicarboxylate is CSNCOKSAYUDNIE-UHFFFAOYSA-N. |
| Q: What is the LogP of Diethyl-2,6-naphthalenedicarboxylate? |
| A: LogP of Diethyl-2,6-naphthalenedicarboxylate is 0.69160. |
| Q: What are the upstream materials of Diethyl-2,6-naphthalenedicarboxylate? |
| A: Related upstream materials(CAS) of Diethyl-2,6-naphthalenedicarboxylate: 64-17-5;1141-38-4;840-65-3. |
| Q: What is the molecular weight of Diethyl-2,6-naphthalenedicarboxylate? |
| A: Molecular weight of Diethyl-2,6-naphthalenedicarboxylate is 272.29. |
| Q: What is the CAS number of Diethyl-2,6-naphthalenedicarboxylate? |
| A: CAS number of Diethyl-2,6-naphthalenedicarboxylate is 15442-73-6. |
| Q: What is the SMILES notation of Diethyl-2,6-naphthalenedicarboxylate? |
| A: SMILES notation of Diethyl-2,6-naphthalenedicarboxylate is CCOC(=O)C1=CC2=C(C=C1)C=C(C=C2)C(=O)OCC. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |