(S)-2-benzyl 1-tert-butyl 4-oxopyrrolidine-1,2-dicarboxylate
(S)-2-benzyl 1-tert-butyl 4-oxopyrrolidine-1,2-dicarboxylate structure
|
Common Name | (S)-2-benzyl 1-tert-butyl 4-oxopyrrolidine-1,2-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 154456-97-0 | Molecular Weight | 319.35200 | |
| Density | 1.219±0.06 g/cm3(Predicted) | Boiling Point | 439.9±45.0 °C(Predicted) | |
| Molecular Formula | C17H21NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-(tert-butyloxycarbonyl)-4-oxoproline benzyl ester |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.219±0.06 g/cm3(Predicted) |
|---|---|
| Boiling Point | 439.9±45.0 °C(Predicted) |
| Molecular Formula | C17H21NO5 |
| Molecular Weight | 319.35200 |
| Exact Mass | 319.14200 |
| PSA | 72.91000 |
| LogP | 2.24620 |
| InChIKey | JBOGNSRGCLEJEM-AWEZNQCLSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(=O)CC1C(=O)OCc1ccccc1 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| benzyl (2S,4R)-N-tert-butoxycarbonyl-4-oxoprolinate |
| benzyl Nα-Boc-4-keto-L-prolinate |
| benzyl (2S)-N-tert-butoxycarbonyl-4-oxoprolinate |
| benzyl (S)-1-tert-butoxycarbonyl-4-oxopyrrolidine-2-carboxylate |
| (S)-2-benzyl 1-tert-butyl 4-oxopyrrolidine-1,2-dicarboxylate |
| 2-benzyl 1-tert-butyl (2S)-4-oxo-1,2-pyrrolidinecarboxylate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of N-(tert-butyloxycarbonyl)-4-oxoproline benzyl ester? |
| A: Molecular weight of N-(tert-butyloxycarbonyl)-4-oxoproline benzyl ester is 319.35200. |
| Q: What is the SMILES notation of N-(tert-butyloxycarbonyl)-4-oxoproline benzyl ester? |
| A: SMILES notation of N-(tert-butyloxycarbonyl)-4-oxoproline benzyl ester is CC(C)(C)OC(=O)N1CC(=O)CC1C(=O)OCc1ccccc1. |
| Q: What is the polar surface area (PSA) of N-(tert-butyloxycarbonyl)-4-oxoproline benzyl ester? |
| A: Polar surface area (PSA) of N-(tert-butyloxycarbonyl)-4-oxoproline benzyl ester is 72.91000. |
| Q: What is the LogP of N-(tert-butyloxycarbonyl)-4-oxoproline benzyl ester? |
| A: LogP of N-(tert-butyloxycarbonyl)-4-oxoproline benzyl ester is 2.24620. |
| Q: What English synonyms does N-(tert-butyloxycarbonyl)-4-oxoproline benzyl ester have? |
| A: English synonyms of N-(tert-butyloxycarbonyl)-4-oxoproline benzyl ester: benzyl (2S,4R)-N-tert-butoxycarbonyl-4-oxoprolinate, benzyl Nα-Boc-4-keto-L-prolinate, benzyl (2S)-N-tert-butoxycarbonyl-4-oxoprolinate, benzyl (S)-1-tert-butoxycarbonyl-4-oxopyrrolidine-2-carboxylate, (S)-2-benzyl 1-tert-butyl 4-oxopyrrolidine-1,2-dicarboxylate, 2-benzyl 1-tert-butyl (2S)-4-oxo-1,2-pyrrolidinecarboxylate. |
| Q: What is the English name of N-(tert-butyloxycarbonyl)-4-oxoproline benzyl ester? |
| A: The English name of N-(tert-butyloxycarbonyl)-4-oxoproline benzyl ester is N-(tert-butyloxycarbonyl)-4-oxoproline benzyl ester. |
| Q: What is the molecular formula of N-(tert-butyloxycarbonyl)-4-oxoproline benzyl ester? |
| A: Molecular formula of N-(tert-butyloxycarbonyl)-4-oxoproline benzyl ester is C17H21NO5. |
| Q: What is the InChIKey of N-(tert-butyloxycarbonyl)-4-oxoproline benzyl ester? |
| A: InChIKey of N-(tert-butyloxycarbonyl)-4-oxoproline benzyl ester is JBOGNSRGCLEJEM-AWEZNQCLSA-N. |
| Q: What is the boiling point of N-(tert-butyloxycarbonyl)-4-oxoproline benzyl ester? |
| A: Boiling point of N-(tert-butyloxycarbonyl)-4-oxoproline benzyl ester is 439.9±45.0 °C(Predicted). |
| Q: What is the CAS number of N-(tert-butyloxycarbonyl)-4-oxoproline benzyl ester? |
| A: CAS number of N-(tert-butyloxycarbonyl)-4-oxoproline benzyl ester is 154456-97-0. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |