2',4,4',5',7,7'-HEXACHLORO-3',6'-DIHYDROXY-3-OXO-3H-SPIRO[ISOBENZOFURAN-1,9'-XANTHENE]-6-CARBOXYLIC ACID structure
|
Common Name | 2',4,4',5',7,7'-HEXACHLORO-3',6'-DIHYDROXY-3-OXO-3H-SPIRO[ISOBENZOFURAN-1,9'-XANTHENE]-6-CARBOXYLIC ACID | ||
|---|---|---|---|---|
| CAS Number | 155911-16-3 | Molecular Weight | 582.98600 | |
| Density | 2.06±0.1 g/cm3(Predicted) | Boiling Point | 794.8±60.0 °C(Predicted) | |
| Molecular Formula | C21H6Cl6O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 2',4,4',5',7,7'-hexachloro-3',6'-dihydroxy-3-oxo-3H-spiro[isobenzofuran-1,9'-xanthene]-6-carboxylic acid, CAS number 155911-16-3, molecular formula C21H6Cl6O7, molecular weight 582.98600. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2',4,4',5',7,7'-hexachloro-3',6'-dihydroxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 2.06±0.1 g/cm3(Predicted) |
|---|---|
| Boiling Point | 794.8±60.0 °C(Predicted) |
| Molecular Formula | C21H6Cl6O7 |
| Molecular Weight | 582.98600 |
| Exact Mass | 579.82400 |
| PSA | 113.29000 |
| LogP | 7.28440 |
| InChIKey | AFBUYXUHQACBAO-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc(Cl)c2c(c1Cl)C1(OC2=O)c2cc(Cl)c(O)c(Cl)c2Oc2c1cc(Cl)c(O)c2Cl |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2',4,4',5',7,7'-Hexachloro-3',6'-dihydroxy-3-oxo-3H-spiro[isobenzofuran-1,9'-xanthene]-6-carboxylic acid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does 2',4,4',5',7,7'-hexachloro-3',6'-dihydroxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carboxylic acid have? |
| A: English synonyms of 2',4,4',5',7,7'-hexachloro-3',6'-dihydroxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carboxylic acid: 2',4,4',5',7,7'-Hexachloro-3',6'-dihydroxy-3-oxo-3H-spiro[isobenzofuran-1,9'-xanthene]-6-carboxylic acid. |
| Q: What is the boiling point of 2',4,4',5',7,7'-hexachloro-3',6'-dihydroxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carboxylic acid? |
| A: Boiling point of 2',4,4',5',7,7'-hexachloro-3',6'-dihydroxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carboxylic acid is 794.8±60.0 °C(Predicted). |
| Q: What is the LogP of 2',4,4',5',7,7'-hexachloro-3',6'-dihydroxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carboxylic acid? |
| A: LogP of 2',4,4',5',7,7'-hexachloro-3',6'-dihydroxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carboxylic acid is 7.28440. |
| Q: What is the InChIKey of 2',4,4',5',7,7'-hexachloro-3',6'-dihydroxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carboxylic acid? |
| A: InChIKey of 2',4,4',5',7,7'-hexachloro-3',6'-dihydroxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carboxylic acid is AFBUYXUHQACBAO-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of 2',4,4',5',7,7'-hexachloro-3',6'-dihydroxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carboxylic acid? |
| A: Polar surface area (PSA) of 2',4,4',5',7,7'-hexachloro-3',6'-dihydroxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carboxylic acid is 113.29000. |
| Q: What is the molecular formula of 2',4,4',5',7,7'-hexachloro-3',6'-dihydroxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carboxylic acid? |
| A: Molecular formula of 2',4,4',5',7,7'-hexachloro-3',6'-dihydroxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carboxylic acid is C21H6Cl6O7. |
| Q: What is the CAS number of 2',4,4',5',7,7'-hexachloro-3',6'-dihydroxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carboxylic acid? |
| A: CAS number of 2',4,4',5',7,7'-hexachloro-3',6'-dihydroxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carboxylic acid is 155911-16-3. |
| Q: What is the SMILES notation of 2',4,4',5',7,7'-hexachloro-3',6'-dihydroxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carboxylic acid? |
| A: SMILES notation of 2',4,4',5',7,7'-hexachloro-3',6'-dihydroxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carboxylic acid is O=C(O)c1cc(Cl)c2c(c1Cl)C1(OC2=O)c2cc(Cl)c(O)c(Cl)c2Oc2c1cc(Cl)c(O)c2Cl. |
| Q: What are the upstream materials of 2',4,4',5',7,7'-hexachloro-3',6'-dihydroxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carboxylic acid? |
| A: Related upstream materials(CAS) of 2',4,4',5',7,7'-hexachloro-3',6'-dihydroxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carboxylic acid: 81742-10-1;16606-61-4. |
| Q: What is the molecular weight of 2',4,4',5',7,7'-hexachloro-3',6'-dihydroxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carboxylic acid? |
| A: Molecular weight of 2',4,4',5',7,7'-hexachloro-3',6'-dihydroxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carboxylic acid is 582.98600. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |