Ethyl 4-(4-bromophenoxy)butanoate
Ethyl 4-(4-bromophenoxy)butanoate structure
|
Common Name | Ethyl 4-(4-bromophenoxy)butanoate | ||
|---|---|---|---|---|
| CAS Number | 157245-87-9 | Molecular Weight | 287.15000 | |
| Density | 1.331±0.06 g/cm3(Predicted) | Boiling Point | 358.7±22.0 °C(Predicted) | |
| Molecular Formula | C12H15BrO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-(4-bromophenoxy)butyric acid ethyl ester |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.331±0.06 g/cm3(Predicted) |
|---|---|
| Boiling Point | 358.7±22.0 °C(Predicted) |
| Molecular Formula | C12H15BrO3 |
| Molecular Weight | 287.15000 |
| Exact Mass | 286.02000 |
| PSA | 35.53000 |
| LogP | 3.17120 |
| InChIKey | QYSNTPAUIDBKKV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CCCOc1ccc(Br)cc1 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| ethyl 4-(4-bromophenoxy)butanoate |
| 4-(4-bromo-phenoxy)-butyric acid ethyl ester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of 4-(4-bromophenoxy)butyric acid ethyl ester? |
| A: Polar surface area (PSA) of 4-(4-bromophenoxy)butyric acid ethyl ester is 35.53000. |
| Q: What is the SMILES notation of 4-(4-bromophenoxy)butyric acid ethyl ester? |
| A: SMILES notation of 4-(4-bromophenoxy)butyric acid ethyl ester is CCOC(=O)CCCOc1ccc(Br)cc1. |
| Q: What English synonyms does 4-(4-bromophenoxy)butyric acid ethyl ester have? |
| A: English synonyms of 4-(4-bromophenoxy)butyric acid ethyl ester: ethyl 4-(4-bromophenoxy)butanoate, 4-(4-bromo-phenoxy)-butyric acid ethyl ester. |
| Q: What is the boiling point of 4-(4-bromophenoxy)butyric acid ethyl ester? |
| A: Boiling point of 4-(4-bromophenoxy)butyric acid ethyl ester is 358.7±22.0 °C(Predicted). |
| Q: What is the molecular weight of 4-(4-bromophenoxy)butyric acid ethyl ester? |
| A: Molecular weight of 4-(4-bromophenoxy)butyric acid ethyl ester is 287.15000. |
| Q: What is the LogP of 4-(4-bromophenoxy)butyric acid ethyl ester? |
| A: LogP of 4-(4-bromophenoxy)butyric acid ethyl ester is 3.17120. |
| Q: What is the CAS number of 4-(4-bromophenoxy)butyric acid ethyl ester? |
| A: CAS number of 4-(4-bromophenoxy)butyric acid ethyl ester is 157245-87-9. |
| Q: What is the molecular formula of 4-(4-bromophenoxy)butyric acid ethyl ester? |
| A: Molecular formula of 4-(4-bromophenoxy)butyric acid ethyl ester is C12H15BrO3. |
| Q: What is the English name of 4-(4-bromophenoxy)butyric acid ethyl ester? |
| A: The English name of 4-(4-bromophenoxy)butyric acid ethyl ester is 4-(4-bromophenoxy)butyric acid ethyl ester. |
| Q: What is the InChIKey of 4-(4-bromophenoxy)butyric acid ethyl ester? |
| A: InChIKey of 4-(4-bromophenoxy)butyric acid ethyl ester is QYSNTPAUIDBKKV-UHFFFAOYSA-N. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |