benzyl 4-(ethylamino)piperidine-1-carboxylate
benzyl 4-(ethylamino)piperidine-1-carboxylate structure
|
Common Name | benzyl 4-(ethylamino)piperidine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 159874-38-1 | Molecular Weight | 262.34700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H22N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | benzyl 4-(ethylamino)piperidine-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H22N2O2 |
|---|---|
| Molecular Weight | 262.34700 |
| Exact Mass | 262.16800 |
| PSA | 41.57000 |
| LogP | 2.72590 |
| InChIKey | AGRCCDZHIDRWPM-UHFFFAOYSA-N |
| SMILES | CCNC1CCN(C(=O)OCc2ccccc2)CC1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2933399090 |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
benzyl 4-(ethyl... CAS#:159874-38-1 |
| Literature: Knust, Henner; Nettekoven, Matthias; Ratni, Hasane; Vifian, Walter; Wu, Xihan Patent: US2009/76081 A1, 2009 ; Location in patent: Page/Page column 11-12 ; US 20090076081 A1 |
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4-Ethylaminopiperidine-1-carboxylic acid benzyl ester |
| 1-Benzyloxycarbonyl-4-(ethylamino)piperidine |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of benzyl 4-(ethylamino)piperidine-1-carboxylate? |
| A: Molecular weight of benzyl 4-(ethylamino)piperidine-1-carboxylate is 262.34700. |
| Q: What is the CAS number of benzyl 4-(ethylamino)piperidine-1-carboxylate? |
| A: CAS number of benzyl 4-(ethylamino)piperidine-1-carboxylate is 159874-38-1. |
| Q: What is the LogP of benzyl 4-(ethylamino)piperidine-1-carboxylate? |
| A: LogP of benzyl 4-(ethylamino)piperidine-1-carboxylate is 2.72590. |
| Q: What is the polar surface area (PSA) of benzyl 4-(ethylamino)piperidine-1-carboxylate? |
| A: Polar surface area (PSA) of benzyl 4-(ethylamino)piperidine-1-carboxylate is 41.57000. |
| Q: What is the molecular formula of benzyl 4-(ethylamino)piperidine-1-carboxylate? |
| A: Molecular formula of benzyl 4-(ethylamino)piperidine-1-carboxylate is C15H22N2O2. |
| Q: What is the SMILES notation of benzyl 4-(ethylamino)piperidine-1-carboxylate? |
| A: SMILES notation of benzyl 4-(ethylamino)piperidine-1-carboxylate is CCNC1CCN(C(=O)OCc2ccccc2)CC1. |
| Q: What is the English name of benzyl 4-(ethylamino)piperidine-1-carboxylate? |
| A: The English name of benzyl 4-(ethylamino)piperidine-1-carboxylate is benzyl 4-(ethylamino)piperidine-1-carboxylate. |
| Q: What English synonyms does benzyl 4-(ethylamino)piperidine-1-carboxylate have? |
| A: English synonyms of benzyl 4-(ethylamino)piperidine-1-carboxylate: 4-Ethylaminopiperidine-1-carboxylic acid benzyl ester, 1-Benzyloxycarbonyl-4-(ethylamino)piperidine. |
| Q: What is the InChIKey of benzyl 4-(ethylamino)piperidine-1-carboxylate? |
| A: InChIKey of benzyl 4-(ethylamino)piperidine-1-carboxylate is AGRCCDZHIDRWPM-UHFFFAOYSA-N. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |