5'-O-DMT-2'-MOE-T
5'-O-DMT-2'-MOE-T structure
|
Common Name | 5'-O-DMT-2'-MOE-T | ||
|---|---|---|---|---|
| CAS Number | 163759-50-0 | Molecular Weight | 618.67400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C34H38N2O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5'-o-dmt-moe-t |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C34H38N2O9 |
|---|---|
| Molecular Weight | 618.67400 |
| Exact Mass | 618.25800 |
| PSA | 130.47000 |
| LogP | 3.16080 |
| InChIKey | WIPCVBQXKBWNRC-PBAMLIMUSA-N |
| SMILES | COCCOC1C(O)C(COC(c2ccccc2)(c2ccc(OC)cc2)c2ccc(OC)cc2)OC1n1cc(C)c(=O)[nH]c1=O |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:163759-49-7
CAS#:182496-01-1This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 5'-O-DMTr- 2'-O-(2-Methoxyethyl)-5-methyl- uridine |
| 5-O-DMTR- 2-O-(2-METHOXYETHYL)-5-METHYL-URIDINE |
| 5'-O-DMT-2'-MOE-T |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 5'-o-dmt-moe-t? |
| A: CAS number of 5'-o-dmt-moe-t is 163759-50-0. |
| Q: What is the LogP of 5'-o-dmt-moe-t? |
| A: LogP of 5'-o-dmt-moe-t is 3.16080. |
| Q: What is the polar surface area (PSA) of 5'-o-dmt-moe-t? |
| A: Polar surface area (PSA) of 5'-o-dmt-moe-t is 130.47000. |
| Q: What is the molecular formula of 5'-o-dmt-moe-t? |
| A: Molecular formula of 5'-o-dmt-moe-t is C34H38N2O9. |
| Q: What is the SMILES notation of 5'-o-dmt-moe-t? |
| A: SMILES notation of 5'-o-dmt-moe-t is COCCOC1C(O)C(COC(c2ccccc2)(c2ccc(OC)cc2)c2ccc(OC)cc2)OC1n1cc(C)c(=O)[nH]c1=O. |
| Q: What is the InChIKey of 5'-o-dmt-moe-t? |
| A: InChIKey of 5'-o-dmt-moe-t is WIPCVBQXKBWNRC-PBAMLIMUSA-N. |
| Q: What are the downstream products of 5'-o-dmt-moe-t? |
| A: Related downstream products(CAS) of 5'-o-dmt-moe-t: 163759-49-7;182496-01-1. |
| Q: What English synonyms does 5'-o-dmt-moe-t have? |
| A: English synonyms of 5'-o-dmt-moe-t: 5'-O-DMTr- 2'-O-(2-Methoxyethyl)-5-methyl- uridine, 5-O-DMTR- 2-O-(2-METHOXYETHYL)-5-METHYL-URIDINE, 5'-O-DMT-2'-MOE-T. |
| Q: What is the molecular weight of 5'-o-dmt-moe-t? |
| A: Molecular weight of 5'-o-dmt-moe-t is 618.67400. |
| Q: What is the English name of 5'-o-dmt-moe-t? |
| A: The English name of 5'-o-dmt-moe-t is 5'-o-dmt-moe-t. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |