1H-PYRROLE-2-PROPANOIC ACID, .BETA.-OXO-, ETHYL ESTER
1H-PYRROLE-2-PROPANOIC ACID, .BETA.-OXO-, ETHYL ESTER structure
|
Common Name | 1H-PYRROLE-2-PROPANOIC ACID, .BETA.-OXO-, ETHYL ESTER | ||
|---|---|---|---|---|
| CAS Number | 169376-35-6 | Molecular Weight | 181.18900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H11NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | ethyl 3-oxo-3-(1H-pyrrol-2-yl)propanoate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H11NO3 |
|---|---|
| Molecular Weight | 181.18900 |
| Exact Mass | 181.07400 |
| PSA | 59.16000 |
| LogP | 1.15060 |
| InChIKey | GPNOESMCLCQOBG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(=O)c1ccc[nH]1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
1H-PYRROLE-2-PR... CAS#:169376-35-6 |
| Literature: Oddo; Moschini Gazzetta Chimica Italiana, 1912 , vol. 42 II, p. 269 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 1 | |
CAS#:18325-18-3This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3-oxo-3-pyrrol-2-yl-propionic acid ethyl ester |
| 2-<1-Oxo-2-ethoxycarbonyl-ethyl>-pyrrol |
| 1H-Pyrrole-2-propanoicacid,b-oxo-,ethyl ester |
| 3-Oxo-3-pyrrol-2-yl-propionsaeure-aethylester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of ethyl 3-oxo-3-(1H-pyrrol-2-yl)propanoate? |
| A: Molecular formula of ethyl 3-oxo-3-(1H-pyrrol-2-yl)propanoate is C9H11NO3. |
| Q: What is the molecular weight of ethyl 3-oxo-3-(1H-pyrrol-2-yl)propanoate? |
| A: Molecular weight of ethyl 3-oxo-3-(1H-pyrrol-2-yl)propanoate is 181.18900. |
| Q: What is the LogP of ethyl 3-oxo-3-(1H-pyrrol-2-yl)propanoate? |
| A: LogP of ethyl 3-oxo-3-(1H-pyrrol-2-yl)propanoate is 1.15060. |
| Q: What English synonyms does ethyl 3-oxo-3-(1H-pyrrol-2-yl)propanoate have? |
| A: English synonyms of ethyl 3-oxo-3-(1H-pyrrol-2-yl)propanoate: 3-oxo-3-pyrrol-2-yl-propionic acid ethyl ester, 2--pyrrol, 1H-Pyrrole-2-propanoicacid,b-oxo-,ethyl ester, 3-Oxo-3-pyrrol-2-yl-propionsaeure-aethylester. |
| Q: What are the upstream materials of ethyl 3-oxo-3-(1H-pyrrol-2-yl)propanoate? |
| A: Related upstream materials(CAS) of ethyl 3-oxo-3-(1H-pyrrol-2-yl)propanoate: 36239-09-5. |
| Q: What is the English name of ethyl 3-oxo-3-(1H-pyrrol-2-yl)propanoate? |
| A: The English name of ethyl 3-oxo-3-(1H-pyrrol-2-yl)propanoate is ethyl 3-oxo-3-(1H-pyrrol-2-yl)propanoate. |
| Q: What is the CAS number of ethyl 3-oxo-3-(1H-pyrrol-2-yl)propanoate? |
| A: CAS number of ethyl 3-oxo-3-(1H-pyrrol-2-yl)propanoate is 169376-35-6. |
| Q: What are the downstream products of ethyl 3-oxo-3-(1H-pyrrol-2-yl)propanoate? |
| A: Related downstream products(CAS) of ethyl 3-oxo-3-(1H-pyrrol-2-yl)propanoate: 18325-18-3. |
| Q: What is the polar surface area (PSA) of ethyl 3-oxo-3-(1H-pyrrol-2-yl)propanoate? |
| A: Polar surface area (PSA) of ethyl 3-oxo-3-(1H-pyrrol-2-yl)propanoate is 59.16000. |
| Q: What is the SMILES notation of ethyl 3-oxo-3-(1H-pyrrol-2-yl)propanoate? |
| A: SMILES notation of ethyl 3-oxo-3-(1H-pyrrol-2-yl)propanoate is CCOC(=O)CC(=O)c1ccc[nH]1. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |