1,3,5-tris(4-pyridyl)benzene
1,3,5-tris(4-pyridyl)benzene structure
|
Common Name | 1,3,5-tris(4-pyridyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 170165-84-1 | Molecular Weight | 309.36400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H15N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-(3,5-dipyridin-4-ylphenyl)pyridine |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C21H15N3 |
|---|---|
| Molecular Weight | 309.36400 |
| Exact Mass | 309.12700 |
| PSA | 38.67000 |
| LogP | 4.87260 |
| InChIKey | ZMQLKBAJUGKDDO-UHFFFAOYSA-N |
| SMILES | c1cc(-c2cc(-c3ccncc3)cc(-c3ccncc3)c2)ccn1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~89%
1,3,5-tris(4-py... CAS#:170165-84-1 |
| Literature: Fujita, Makoto; Oka, Hiroko; Ogura, Katsuyuki Tetrahedron Letters, 1995 , vol. 36, # 29 p. 5247 - 5250 |
|
~83%
1,3,5-tris(4-py... CAS#:170165-84-1 |
| Literature: Schmittel, Michael; He, Bice; Mal, Prasenjit Organic Letters, 2008 , vol. 10, # 12 p. 2513 - 2516 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1,3,5-tris(4-pyridyl)benzene |
| Pyridine,4,4',4''-(1,3,5-benzenetriyl)tris |
| 1,3,5-tri(4-pyridyl)benzene |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 4-(3,5-dipyridin-4-ylphenyl)pyridine? |
| A: InChIKey of 4-(3,5-dipyridin-4-ylphenyl)pyridine is ZMQLKBAJUGKDDO-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of 4-(3,5-dipyridin-4-ylphenyl)pyridine? |
| A: Polar surface area (PSA) of 4-(3,5-dipyridin-4-ylphenyl)pyridine is 38.67000. |
| Q: What is the SMILES notation of 4-(3,5-dipyridin-4-ylphenyl)pyridine? |
| A: SMILES notation of 4-(3,5-dipyridin-4-ylphenyl)pyridine is c1cc(-c2cc(-c3ccncc3)cc(-c3ccncc3)c2)ccn1. |
| Q: What is the molecular formula of 4-(3,5-dipyridin-4-ylphenyl)pyridine? |
| A: Molecular formula of 4-(3,5-dipyridin-4-ylphenyl)pyridine is C21H15N3. |
| Q: What is the molecular weight of 4-(3,5-dipyridin-4-ylphenyl)pyridine? |
| A: Molecular weight of 4-(3,5-dipyridin-4-ylphenyl)pyridine is 309.36400. |
| Q: What is the LogP of 4-(3,5-dipyridin-4-ylphenyl)pyridine? |
| A: LogP of 4-(3,5-dipyridin-4-ylphenyl)pyridine is 4.87260. |
| Q: What English synonyms does 4-(3,5-dipyridin-4-ylphenyl)pyridine have? |
| A: English synonyms of 4-(3,5-dipyridin-4-ylphenyl)pyridine: 1,3,5-tris(4-pyridyl)benzene, Pyridine,4,4',4''-(1,3,5-benzenetriyl)tris, 1,3,5-tri(4-pyridyl)benzene. |
| Q: What is the English name of 4-(3,5-dipyridin-4-ylphenyl)pyridine? |
| A: The English name of 4-(3,5-dipyridin-4-ylphenyl)pyridine is 4-(3,5-dipyridin-4-ylphenyl)pyridine. |
| Q: What is the CAS number of 4-(3,5-dipyridin-4-ylphenyl)pyridine? |
| A: CAS number of 4-(3,5-dipyridin-4-ylphenyl)pyridine is 170165-84-1. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |
| Henan Tianfu Chemical Co., Ltd. |