6-((((9H-Fluoren-9-yl)methoxy)carbonyl)(methyl)amino)hexanoic acid
6-((((9H-Fluoren-9-yl)methoxy)carbonyl)(methyl)amino)hexanoic acid structure
|
Common Name | 6-((((9H-Fluoren-9-yl)methoxy)carbonyl)(methyl)amino)hexanoic acid | ||
|---|---|---|---|---|
| CAS Number | 173690-47-6 | Molecular Weight | 367.43800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H25NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6-[[2-(9H-fluoren-9-ylmethoxy)-2-oxoethyl]amino]hexanoic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C22H25NO4 |
|---|---|
| Molecular Weight | 367.43800 |
| Exact Mass | 367.17800 |
| PSA | 75.63000 |
| LogP | 3.96760 |
| InChIKey | PNRDWMGJZQEECF-UHFFFAOYSA-N |
| SMILES | CN(CCCCCC(=O)O)C(=O)OCC1c2ccccc2-c2ccccc21 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
6-((((9H-Fluore... CAS#:173690-47-6 |
| Literature: Luke, Richard W. A.; Boyce, Patrick G. T.; Dorling, E. Kate Tetrahedron Letters, 1996 , vol. 37, # 2 p. 263 - 266 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| MFCD30596881 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 6-[[2-(9H-fluoren-9-ylmethoxy)-2-oxoethyl]amino]hexanoic acid? |
| A: InChIKey of 6-[[2-(9H-fluoren-9-ylmethoxy)-2-oxoethyl]amino]hexanoic acid is PNRDWMGJZQEECF-UHFFFAOYSA-N. |
| Q: What is the CAS number of 6-[[2-(9H-fluoren-9-ylmethoxy)-2-oxoethyl]amino]hexanoic acid? |
| A: CAS number of 6-[[2-(9H-fluoren-9-ylmethoxy)-2-oxoethyl]amino]hexanoic acid is 173690-47-6. |
| Q: What is the English name of 6-[[2-(9H-fluoren-9-ylmethoxy)-2-oxoethyl]amino]hexanoic acid? |
| A: The English name of 6-[[2-(9H-fluoren-9-ylmethoxy)-2-oxoethyl]amino]hexanoic acid is 6-[[2-(9H-fluoren-9-ylmethoxy)-2-oxoethyl]amino]hexanoic acid. |
| Q: What is the SMILES notation of 6-[[2-(9H-fluoren-9-ylmethoxy)-2-oxoethyl]amino]hexanoic acid? |
| A: SMILES notation of 6-[[2-(9H-fluoren-9-ylmethoxy)-2-oxoethyl]amino]hexanoic acid is CN(CCCCCC(=O)O)C(=O)OCC1c2ccccc2-c2ccccc21. |
| Q: What English synonyms does 6-[[2-(9H-fluoren-9-ylmethoxy)-2-oxoethyl]amino]hexanoic acid have? |
| A: English synonyms of 6-[[2-(9H-fluoren-9-ylmethoxy)-2-oxoethyl]amino]hexanoic acid: MFCD30596881. |
| Q: What is the LogP of 6-[[2-(9H-fluoren-9-ylmethoxy)-2-oxoethyl]amino]hexanoic acid? |
| A: LogP of 6-[[2-(9H-fluoren-9-ylmethoxy)-2-oxoethyl]amino]hexanoic acid is 3.96760. |
| Q: What is the molecular formula of 6-[[2-(9H-fluoren-9-ylmethoxy)-2-oxoethyl]amino]hexanoic acid? |
| A: Molecular formula of 6-[[2-(9H-fluoren-9-ylmethoxy)-2-oxoethyl]amino]hexanoic acid is C22H25NO4. |
| Q: What is the molecular weight of 6-[[2-(9H-fluoren-9-ylmethoxy)-2-oxoethyl]amino]hexanoic acid? |
| A: Molecular weight of 6-[[2-(9H-fluoren-9-ylmethoxy)-2-oxoethyl]amino]hexanoic acid is 367.43800. |
| Q: What is the polar surface area (PSA) of 6-[[2-(9H-fluoren-9-ylmethoxy)-2-oxoethyl]amino]hexanoic acid? |
| A: Polar surface area (PSA) of 6-[[2-(9H-fluoren-9-ylmethoxy)-2-oxoethyl]amino]hexanoic acid is 75.63000. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |