Methyl 4-Hydroxy-[1,1’-Biphenyl]-3-Carboxylate
![Methyl 4-Hydroxy-[1,1’-Biphenyl]-3-Carboxylate Structure](https://image.chemsrc.com/caspic/468/17504-13-1.png)
Methyl 4-Hydroxy-[1,1’-Biphenyl]-3-Carboxylate structure
|
Common Name | Methyl 4-Hydroxy-[1,1’-Biphenyl]-3-Carboxylate | ||
|---|---|---|---|---|
| CAS Number | 17504-13-1 | Molecular Weight | 228.24300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H12O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | methyl 4-hydroxy-1,1'-biphenyl-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H12O3 |
|---|---|
| Molecular Weight | 228.24300 |
| Exact Mass | 228.07900 |
| PSA | 46.53000 |
| LogP | 2.84580 |
| InChIKey | ANCWLMBYNOSXQA-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(-c2ccccc2)ccc1O |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| methyl 5-phenylsalicylate |
| 4-Hydroxy-biphenyl-3-carbonsaeure-methylester |
| 4-hydroxybiphenyl-3-carboxylic acid methyl ester |
| 4-hydroxy-biphenyl-3-carboxylic acid methyl ester |
| methyl 2-hydroxy-5-phenylbenzoate |
| methyl 4-hydroxybiphenyl-3-carboxylate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of methyl 4-hydroxy-1,1'-biphenyl-3-carboxylate? |
| A: LogP of methyl 4-hydroxy-1,1'-biphenyl-3-carboxylate is 2.84580. |
| Q: What is the InChIKey of methyl 4-hydroxy-1,1'-biphenyl-3-carboxylate? |
| A: InChIKey of methyl 4-hydroxy-1,1'-biphenyl-3-carboxylate is ANCWLMBYNOSXQA-UHFFFAOYSA-N. |
| Q: What English synonyms does methyl 4-hydroxy-1,1'-biphenyl-3-carboxylate have? |
| A: English synonyms of methyl 4-hydroxy-1,1'-biphenyl-3-carboxylate: methyl 5-phenylsalicylate, 4-Hydroxy-biphenyl-3-carbonsaeure-methylester, 4-hydroxybiphenyl-3-carboxylic acid methyl ester, 4-hydroxy-biphenyl-3-carboxylic acid methyl ester, methyl 2-hydroxy-5-phenylbenzoate, methyl 4-hydroxybiphenyl-3-carboxylate. |
| Q: What is the molecular weight of methyl 4-hydroxy-1,1'-biphenyl-3-carboxylate? |
| A: Molecular weight of methyl 4-hydroxy-1,1'-biphenyl-3-carboxylate is 228.24300. |
| Q: What is the CAS number of methyl 4-hydroxy-1,1'-biphenyl-3-carboxylate? |
| A: CAS number of methyl 4-hydroxy-1,1'-biphenyl-3-carboxylate is 17504-13-1. |
| Q: What is the polar surface area (PSA) of methyl 4-hydroxy-1,1'-biphenyl-3-carboxylate? |
| A: Polar surface area (PSA) of methyl 4-hydroxy-1,1'-biphenyl-3-carboxylate is 46.53000. |
| Q: What is the English name of methyl 4-hydroxy-1,1'-biphenyl-3-carboxylate? |
| A: The English name of methyl 4-hydroxy-1,1'-biphenyl-3-carboxylate is methyl 4-hydroxy-1,1'-biphenyl-3-carboxylate. |
| Q: What is the molecular formula of methyl 4-hydroxy-1,1'-biphenyl-3-carboxylate? |
| A: Molecular formula of methyl 4-hydroxy-1,1'-biphenyl-3-carboxylate is C14H12O3. |
| Q: What is the SMILES notation of methyl 4-hydroxy-1,1'-biphenyl-3-carboxylate? |
| A: SMILES notation of methyl 4-hydroxy-1,1'-biphenyl-3-carboxylate is COC(=O)c1cc(-c2ccccc2)ccc1O. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |