Methyl 2-([1,1'-biphenyl]-4-yl)-2-aminoacetate hydrochloride
Modify Date: 2025-11-28 07:41:11
![Methyl 2-([1,1'-biphenyl]-4-yl)-2-aminoacetate hydrochloride Structure](https://image.chemsrc.com/caspic/362/179811-50-8.png)
Methyl 2-([1,1'-biphenyl]-4-yl)-2-aminoacetate hydrochloride structure
|
Common Name | Methyl 2-([1,1'-biphenyl]-4-yl)-2-aminoacetate hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 179811-50-8 | Molecular Weight | 277.75 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H16ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Methyl 2-([1,1'-biphenyl]-4-yl)-2-aminoacetate hydrochloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H16ClNO2 |
|---|---|
| Molecular Weight | 277.75 |
| InChIKey | BCBLYFLMCWOAGT-UHFFFAOYSA-N |
| SMILES | COC(=O)C(N)c1ccc(-c2ccccc2)cc1.Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of Methyl 2-([1,1'-biphenyl]-4-yl)-2-aminoacetate hydrochloride? |
| A: CAS number of Methyl 2-([1,1'-biphenyl]-4-yl)-2-aminoacetate hydrochloride is 179811-50-8. |
| Q: What is the molecular formula of Methyl 2-([1,1'-biphenyl]-4-yl)-2-aminoacetate hydrochloride? |
| A: Molecular formula of Methyl 2-([1,1'-biphenyl]-4-yl)-2-aminoacetate hydrochloride is C15H16ClNO2. |
| Q: What is the molecular weight of Methyl 2-([1,1'-biphenyl]-4-yl)-2-aminoacetate hydrochloride? |
| A: Molecular weight of Methyl 2-([1,1'-biphenyl]-4-yl)-2-aminoacetate hydrochloride is 277.75. |
| Q: What is the English name of Methyl 2-([1,1'-biphenyl]-4-yl)-2-aminoacetate hydrochloride? |
| A: The English name of Methyl 2-([1,1'-biphenyl]-4-yl)-2-aminoacetate hydrochloride is Methyl 2-([1,1'-biphenyl]-4-yl)-2-aminoacetate hydrochloride. |
| Q: What is the InChIKey of Methyl 2-([1,1'-biphenyl]-4-yl)-2-aminoacetate hydrochloride? |
| A: InChIKey of Methyl 2-([1,1'-biphenyl]-4-yl)-2-aminoacetate hydrochloride is BCBLYFLMCWOAGT-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of Methyl 2-([1,1'-biphenyl]-4-yl)-2-aminoacetate hydrochloride? |
| A: SMILES notation of Methyl 2-([1,1'-biphenyl]-4-yl)-2-aminoacetate hydrochloride is COC(=O)C(N)c1ccc(-c2ccccc2)cc1.Cl. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |