Boc-D-aspartinol 4-Benzyl Ester
Boc-D-aspartinol 4-Benzyl Ester structure
|
Common Name | Boc-D-aspartinol 4-Benzyl Ester | ||
|---|---|---|---|---|
| CAS Number | 182748-72-7 | Molecular Weight | 309.35800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H23NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | benzyl (R)-3-(tert-butoxycarbonylamino)-4-hydroxybutanoate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H23NO5 |
|---|---|
| Molecular Weight | 309.35800 |
| Exact Mass | 309.15800 |
| PSA | 84.86000 |
| LogP | 2.39640 |
| InChIKey | XEGSFNZVTUGZCK-CYBMUJFWSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CO)CC(=O)OCc1ccccc1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 3 | |
CAS#:1135149-01-7
CAS#:137105-97-6
CAS#:749208-35-3This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| (R)-Benzyl 3-((tert-butoxycarbonyl)amino)-4-hydroxybutanoate |
| Boc-D-aspartinol 4-Benzyl Ester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of benzyl (R)-3-(tert-butoxycarbonylamino)-4-hydroxybutanoate? |
| A: SMILES notation of benzyl (R)-3-(tert-butoxycarbonylamino)-4-hydroxybutanoate is CC(C)(C)OC(=O)NC(CO)CC(=O)OCc1ccccc1. |
| Q: What is the molecular formula of benzyl (R)-3-(tert-butoxycarbonylamino)-4-hydroxybutanoate? |
| A: Molecular formula of benzyl (R)-3-(tert-butoxycarbonylamino)-4-hydroxybutanoate is C16H23NO5. |
| Q: What is the LogP of benzyl (R)-3-(tert-butoxycarbonylamino)-4-hydroxybutanoate? |
| A: LogP of benzyl (R)-3-(tert-butoxycarbonylamino)-4-hydroxybutanoate is 2.39640. |
| Q: What is the English name of benzyl (R)-3-(tert-butoxycarbonylamino)-4-hydroxybutanoate? |
| A: The English name of benzyl (R)-3-(tert-butoxycarbonylamino)-4-hydroxybutanoate is benzyl (R)-3-(tert-butoxycarbonylamino)-4-hydroxybutanoate. |
| Q: What is the InChIKey of benzyl (R)-3-(tert-butoxycarbonylamino)-4-hydroxybutanoate? |
| A: InChIKey of benzyl (R)-3-(tert-butoxycarbonylamino)-4-hydroxybutanoate is XEGSFNZVTUGZCK-CYBMUJFWSA-N. |
| Q: What is the polar surface area (PSA) of benzyl (R)-3-(tert-butoxycarbonylamino)-4-hydroxybutanoate? |
| A: Polar surface area (PSA) of benzyl (R)-3-(tert-butoxycarbonylamino)-4-hydroxybutanoate is 84.86000. |
| Q: What are the downstream products of benzyl (R)-3-(tert-butoxycarbonylamino)-4-hydroxybutanoate? |
| A: Related downstream products(CAS) of benzyl (R)-3-(tert-butoxycarbonylamino)-4-hydroxybutanoate: 1135149-01-7;137105-97-6;749208-35-3. |
| Q: What is the molecular weight of benzyl (R)-3-(tert-butoxycarbonylamino)-4-hydroxybutanoate? |
| A: Molecular weight of benzyl (R)-3-(tert-butoxycarbonylamino)-4-hydroxybutanoate is 309.35800. |
| Q: What is the CAS number of benzyl (R)-3-(tert-butoxycarbonylamino)-4-hydroxybutanoate? |
| A: CAS number of benzyl (R)-3-(tert-butoxycarbonylamino)-4-hydroxybutanoate is 182748-72-7. |
| Q: What English synonyms does benzyl (R)-3-(tert-butoxycarbonylamino)-4-hydroxybutanoate have? |
| A: English synonyms of benzyl (R)-3-(tert-butoxycarbonylamino)-4-hydroxybutanoate: (R)-Benzyl 3-((tert-butoxycarbonyl)amino)-4-hydroxybutanoate, Boc-D-aspartinol 4-Benzyl Ester. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |