Methyl 2-methyl-1H-indole-6-carboxylate
Methyl 2-methyl-1H-indole-6-carboxylate structure
|
Common Name | Methyl 2-methyl-1H-indole-6-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 184150-96-7 | Molecular Weight | 189.210 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 341.9±22.0 °C at 760 mmHg | |
| Molecular Formula | C11H11NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 160.6±22.3 °C | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | methyl 2-methylindole-6-carboxylate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 341.9±22.0 °C at 760 mmHg |
| Molecular Formula | C11H11NO2 |
| Molecular Weight | 189.210 |
| Flash Point | 160.6±22.3 °C |
| Exact Mass | 189.078979 |
| PSA | 42.09000 |
| LogP | 2.58 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.624 |
| InChIKey | BGEBSRRTTLVBFL-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc2cc(C)[nH]c2c1 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1H-Indole-6-carboxylic acid, 2-methyl-, methyl ester |
| 2-METHYL-1H-INDOLE-6-CARBOXYLIC ACID METHYL ESTER |
| methyl 2-methyl-1H-indol-6-carboxylate |
| Methyl 2-methyl-1H-indole-6-carboxylate |
| 6-methoxycarbonyl-2-methylindole |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of methyl 2-methylindole-6-carboxylate? |
| A: InChIKey of methyl 2-methylindole-6-carboxylate is BGEBSRRTTLVBFL-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of methyl 2-methylindole-6-carboxylate? |
| A: Polar surface area (PSA) of methyl 2-methylindole-6-carboxylate is 42.09000. |
| Q: What is the molecular formula of methyl 2-methylindole-6-carboxylate? |
| A: Molecular formula of methyl 2-methylindole-6-carboxylate is C11H11NO2. |
| Q: What is the CAS number of methyl 2-methylindole-6-carboxylate? |
| A: CAS number of methyl 2-methylindole-6-carboxylate is 184150-96-7. |
| Q: What is the boiling point of methyl 2-methylindole-6-carboxylate? |
| A: Boiling point of methyl 2-methylindole-6-carboxylate is 341.9±22.0 °C at 760 mmHg. |
| Q: What is the LogP of methyl 2-methylindole-6-carboxylate? |
| A: LogP of methyl 2-methylindole-6-carboxylate is 2.58. |
| Q: What is the molecular weight of methyl 2-methylindole-6-carboxylate? |
| A: Molecular weight of methyl 2-methylindole-6-carboxylate is 189.210. |
| Q: What is the SMILES notation of methyl 2-methylindole-6-carboxylate? |
| A: SMILES notation of methyl 2-methylindole-6-carboxylate is COC(=O)c1ccc2cc(C)[nH]c2c1. |
| Q: What English synonyms does methyl 2-methylindole-6-carboxylate have? |
| A: English synonyms of methyl 2-methylindole-6-carboxylate: 1H-Indole-6-carboxylic acid, 2-methyl-, methyl ester, 2-METHYL-1H-INDOLE-6-CARBOXYLIC ACID METHYL ESTER, methyl 2-methyl-1H-indol-6-carboxylate, Methyl 2-methyl-1H-indole-6-carboxylate, 6-methoxycarbonyl-2-methylindole. |
| Q: What is the English name of methyl 2-methylindole-6-carboxylate? |
| A: The English name of methyl 2-methylindole-6-carboxylate is methyl 2-methylindole-6-carboxylate. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |