3-[3,5-bis(3-aminophenyl)phenyl]aniline
![3-[3,5-bis(3-aminophenyl)phenyl]aniline Structure](https://image.chemsrc.com/caspic/442/184650-02-0.png)
3-[3,5-bis(3-aminophenyl)phenyl]aniline structure
|
Common Name | 3-[3,5-bis(3-aminophenyl)phenyl]aniline | ||
|---|---|---|---|---|
| CAS Number | 184650-02-0 | Molecular Weight | 351.44400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H21N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-[3,5-bis(3-aminophenyl)phenyl]aniline |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C24H21N3 |
|---|---|
| Molecular Weight | 351.44400 |
| Exact Mass | 351.17400 |
| PSA | 78.06000 |
| LogP | 7.17780 |
| InChIKey | NMBMQQDNMNJFPG-UHFFFAOYSA-N |
| SMILES | Nc1cccc(-c2cc(-c3cccc(N)c3)cc(-c3cccc(N)c3)c2)c1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~94%
3-[3,5-bis(3-am... CAS#:184650-02-0 |
| Literature: Pieters, Roland J.; Diederich, Francois Chemical Communications, 1996 , # 19 p. 2255 - 2256 |
|
~%
3-[3,5-bis(3-am... CAS#:184650-02-0 |
| Literature: Xu, Wen-Zhi; Huang, Zhi-Tang; Zheng, Qi-Yu Tetrahedron Letters, 2008 , vol. 49, # 33 p. 4918 - 4921 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 3-[3,5-bis(3-aminophenyl)phenyl]aniline? |
| A: The English name of 3-[3,5-bis(3-aminophenyl)phenyl]aniline is 3-[3,5-bis(3-aminophenyl)phenyl]aniline. |
| Q: What is the Chinese name of 184650-02-0? |
| A: Chinese name of 184650-02-0 is 184650-02-0. |
| Q: What is the polar surface area (PSA) of 3-[3,5-bis(3-aminophenyl)phenyl]aniline? |
| A: Polar surface area (PSA) of 3-[3,5-bis(3-aminophenyl)phenyl]aniline is 78.06000. |
| Q: What is the molecular weight of 3-[3,5-bis(3-aminophenyl)phenyl]aniline? |
| A: Molecular weight of 3-[3,5-bis(3-aminophenyl)phenyl]aniline is 351.44400. |
| Q: What is the LogP of 3-[3,5-bis(3-aminophenyl)phenyl]aniline? |
| A: LogP of 3-[3,5-bis(3-aminophenyl)phenyl]aniline is 7.17780. |
| Q: What is the molecular formula of 3-[3,5-bis(3-aminophenyl)phenyl]aniline? |
| A: Molecular formula of 3-[3,5-bis(3-aminophenyl)phenyl]aniline is C24H21N3. |
| Q: What is the SMILES notation of 3-[3,5-bis(3-aminophenyl)phenyl]aniline? |
| A: SMILES notation of 3-[3,5-bis(3-aminophenyl)phenyl]aniline is Nc1cccc(-c2cc(-c3cccc(N)c3)cc(-c3cccc(N)c3)c2)c1. |
| Q: What is the InChIKey of 3-[3,5-bis(3-aminophenyl)phenyl]aniline? |
| A: InChIKey of 3-[3,5-bis(3-aminophenyl)phenyl]aniline is NMBMQQDNMNJFPG-UHFFFAOYSA-N. |
| Q: What is the CAS number of 3-[3,5-bis(3-aminophenyl)phenyl]aniline? |
| A: CAS number of 3-[3,5-bis(3-aminophenyl)phenyl]aniline is 184650-02-0. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |