N-(2-Nitrobenzyl)ethanamine
Modify Date: 2026-08-08 18:40:50
N-(2-Nitrobenzyl)ethanamine structure
|
Common Name | N-(2-Nitrobenzyl)ethanamine | ||
|---|---|---|---|---|
| CAS Number | 186797-08-0 | Molecular Weight | 180.204 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 268.3±15.0 °C at 760 mmHg | |
| Molecular Formula | C9H12N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 116.0±20.4 °C | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-(2-Nitrobenzyl)ethanamine |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 268.3±15.0 °C at 760 mmHg |
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 180.204 |
| Flash Point | 116.0±20.4 °C |
| Exact Mass | 180.089874 |
| LogP | 1.78 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.547 |
| InChIKey | OBWDZKHLYOUOCP-UHFFFAOYSA-N |
| SMILES | CCNCc1ccccc1[N+](=O)[O-] |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| MFCD09806453 |
| ethyl[(2-nitrophenyl)methyl]amine |
| N-(2-Nitrobenzyl)ethanamine |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of N-(2-Nitrobenzyl)ethanamine? |
| A: LogP of N-(2-Nitrobenzyl)ethanamine is 1.78. |
| Q: What is the Chinese name of 186797-08-0? |
| A: Chinese name of 186797-08-0 is 186797-08-0. |
| Q: What is the CAS number of N-(2-Nitrobenzyl)ethanamine? |
| A: CAS number of N-(2-Nitrobenzyl)ethanamine is 186797-08-0. |
| Q: What is the SMILES notation of N-(2-Nitrobenzyl)ethanamine? |
| A: SMILES notation of N-(2-Nitrobenzyl)ethanamine is CCNCc1ccccc1[N+](=O)[O-]. |
| Q: What English synonyms does N-(2-Nitrobenzyl)ethanamine have? |
| A: English synonyms of N-(2-Nitrobenzyl)ethanamine: MFCD09806453, ethyl[(2-nitrophenyl)methyl]amine, N-(2-Nitrobenzyl)ethanamine. |
| Q: What is the molecular weight of N-(2-Nitrobenzyl)ethanamine? |
| A: Molecular weight of N-(2-Nitrobenzyl)ethanamine is 180.204. |
| Q: What is the English name of N-(2-Nitrobenzyl)ethanamine? |
| A: The English name of N-(2-Nitrobenzyl)ethanamine is N-(2-Nitrobenzyl)ethanamine. |
| Q: What is the InChIKey of N-(2-Nitrobenzyl)ethanamine? |
| A: InChIKey of N-(2-Nitrobenzyl)ethanamine is OBWDZKHLYOUOCP-UHFFFAOYSA-N. |
| Q: What is the molecular formula of N-(2-Nitrobenzyl)ethanamine? |
| A: Molecular formula of N-(2-Nitrobenzyl)ethanamine is C9H12N2O2. |
| Q: What is the boiling point of N-(2-Nitrobenzyl)ethanamine? |
| A: Boiling point of N-(2-Nitrobenzyl)ethanamine is 268.3±15.0 °C at 760 mmHg. |