4,5,9,10-Pyrenetetrone, 2,7-bis(1,1-dimethylethyl)
4,5,9,10-Pyrenetetrone, 2,7-bis(1,1-dimethylethyl) structure
|
Common Name | 4,5,9,10-Pyrenetetrone, 2,7-bis(1,1-dimethylethyl) | ||
|---|---|---|---|---|
| CAS Number | 190843-93-7 | Molecular Weight | 374.42900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H22O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,7-ditert-butylpyrene-4,5,9,10-tetrone |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C24H22O4 |
|---|---|
| Molecular Weight | 374.42900 |
| Exact Mass | 374.15200 |
| PSA | 68.28000 |
| LogP | 3.44700 |
| InChIKey | TYHKMVKSHVDGOG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1cc2c3c(c1)c(=O)c(=O)c1cc(C(C)(C)C)cc(c1-3)c(=O)c2=O |
| Storage condition | 2-8℃ |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2,7-di-t-butylpyrene-4,5-9,10-tetraone |
| 2,7-di-tert-butyl-pyrene-4,5,9,10-tetraone |
| 2,7-di-tert-butyl-4,5,9,10-tetraketopyrene |
| 4,5,9,10-Pyrenetetrone,2,7-bis(1,1-dimethylethyl) |
| 2,7-di-tert-butylpyrene-4,5,9,10-tetrone |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 2,7-ditert-butylpyrene-4,5,9,10-tetrone? |
| A: LogP of 2,7-ditert-butylpyrene-4,5,9,10-tetrone is 3.44700. |
| Q: What English synonyms does 2,7-ditert-butylpyrene-4,5,9,10-tetrone have? |
| A: English synonyms of 2,7-ditert-butylpyrene-4,5,9,10-tetrone: 2,7-di-t-butylpyrene-4,5-9,10-tetraone, 2,7-di-tert-butyl-pyrene-4,5,9,10-tetraone, 2,7-di-tert-butyl-4,5,9,10-tetraketopyrene, 4,5,9,10-Pyrenetetrone,2,7-bis(1,1-dimethylethyl), 2,7-di-tert-butylpyrene-4,5,9,10-tetrone. |
| Q: What is the SMILES notation of 2,7-ditert-butylpyrene-4,5,9,10-tetrone? |
| A: SMILES notation of 2,7-ditert-butylpyrene-4,5,9,10-tetrone is CC(C)(C)c1cc2c3c(c1)c(=O)c(=O)c1cc(C(C)(C)C)cc(c1-3)c(=O)c2=O. |
| Q: What is the English name of 2,7-ditert-butylpyrene-4,5,9,10-tetrone? |
| A: The English name of 2,7-ditert-butylpyrene-4,5,9,10-tetrone is 2,7-ditert-butylpyrene-4,5,9,10-tetrone. |
| Q: What is the InChIKey of 2,7-ditert-butylpyrene-4,5,9,10-tetrone? |
| A: InChIKey of 2,7-ditert-butylpyrene-4,5,9,10-tetrone is TYHKMVKSHVDGOG-UHFFFAOYSA-N. |
| Q: What is the CAS number of 2,7-ditert-butylpyrene-4,5,9,10-tetrone? |
| A: CAS number of 2,7-ditert-butylpyrene-4,5,9,10-tetrone is 190843-93-7. |
| Q: What is the molecular formula of 2,7-ditert-butylpyrene-4,5,9,10-tetrone? |
| A: Molecular formula of 2,7-ditert-butylpyrene-4,5,9,10-tetrone is C24H22O4. |
| Q: What is the molecular weight of 2,7-ditert-butylpyrene-4,5,9,10-tetrone? |
| A: Molecular weight of 2,7-ditert-butylpyrene-4,5,9,10-tetrone is 374.42900. |
| Q: What are the storage conditions for 2,7-ditert-butylpyrene-4,5,9,10-tetrone? |
| A: Storage conditions for 2,7-ditert-butylpyrene-4,5,9,10-tetrone: 2-8℃. |
| Q: What is the polar surface area (PSA) of 2,7-ditert-butylpyrene-4,5,9,10-tetrone? |
| A: Polar surface area (PSA) of 2,7-ditert-butylpyrene-4,5,9,10-tetrone is 68.28000. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |