1,4-dinitroimidazole structure
|
Common Name | 1,4-dinitroimidazole | ||
|---|---|---|---|---|
| CAS Number | 19182-81-1 | Molecular Weight | 158.072 | |
| Density | 2.0±0.1 g/cm3 | Boiling Point | 433.7±37.0 °C at 760 mmHg | |
| Molecular Formula | C3H2N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 216.1±26.5 °C | |
| Name | 1,4-dinitroimidazole |
|---|---|
| Synonym | More Synonyms |
| Density | 2.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 433.7±37.0 °C at 760 mmHg |
| Molecular Formula | C3H2N4O4 |
| Molecular Weight | 158.072 |
| Flash Point | 216.1±26.5 °C |
| Exact Mass | 158.007599 |
| PSA | 109.46000 |
| LogP | -0.31 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.755 |
| InChIKey | HZPSREFSUPXCMN-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cn([N+](=O)[O-])cn1 |
| HS Code | 2933290090 |
|---|
|
~95%
1,4-dinitroimidazole CAS#:19182-81-1 |
| Literature: Cho, Jin Rai; Kim, Kwang Joo; Cho, Soo Gyeong; Kim, Jeong Kook Journal of Heterocyclic Chemistry, 2002 , vol. 39, # 1 p. 141 - 148 |
|
~7%
1,4-dinitroimidazole CAS#:19182-81-1 |
| Literature: Journal of Chemical Research - Part S, , # 5 p. 244 - 245 |
| Precursor 2 | |
|---|---|
| DownStream 10 | |
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1,4-Dinitro-1H-imidazole |
| 1,4 dinitroimidazole |
| 1,4-dinitroimidazole |
| T5N CNJ ANW DNW |
| AmbscL03/098 |
| 1H-Imidazole,1,4-dinitro |