TRANS,TRANS-5-(4-(DIMETHYLAMINO)PHENYL)- 2,4-PENTADIENAL
TRANS,TRANS-5-(4-(DIMETHYLAMINO)PHENYL)- 2,4-PENTADIENAL structure
|
Common Name | TRANS,TRANS-5-(4-(DIMETHYLAMINO)PHENYL)- 2,4-PENTADIENAL | ||
|---|---|---|---|---|
| CAS Number | 20432-36-4 | Molecular Weight | 201.26400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H15NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (2E,4E)-5-[4-(N,N-dimethylamino)phenyl]penta-2,4-dienal |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H15NO |
|---|---|
| Molecular Weight | 201.26400 |
| Exact Mass | 201.11500 |
| PSA | 20.31000 |
| LogP | 2.52090 |
| InChIKey | JYHAOJGBXVCDOC-GGWOSOGESA-N |
| SMILES | CN(C)c1ccc(C=CC=CC=O)cc1 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| (2E,4E)-5-(4-Dimethylamino-phenyl)-penta-2,4-dienal |
| (2E,4E)-5-(4-(dimethylamino)phenyl)penta-2,4-dienal |
| 5-(4'-N,N-dimethylaminophenyl)-2,4-pentadienal |
| 5-(4-N,N-dimethylaminophenyl)penta-2,4-dienal |
| 5-(4-(N,N-dimethylamino)phenyl)-2,4-pentadienal |
| (E,E)-5-(4-(Dimethylamino)phenyl)-2,4-pentadienal |
| (2E,4E)-5-[4-(dimethylamino)phenyl]penta-2,4-dienal |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of (2E,4E)-5-[4-(N,N-dimethylamino)phenyl]penta-2,4-dienal? |
| A: InChIKey of (2E,4E)-5-[4-(N,N-dimethylamino)phenyl]penta-2,4-dienal is JYHAOJGBXVCDOC-GGWOSOGESA-N. |
| Q: What is the LogP of (2E,4E)-5-[4-(N,N-dimethylamino)phenyl]penta-2,4-dienal? |
| A: LogP of (2E,4E)-5-[4-(N,N-dimethylamino)phenyl]penta-2,4-dienal is 2.52090. |
| Q: What is the molecular formula of (2E,4E)-5-[4-(N,N-dimethylamino)phenyl]penta-2,4-dienal? |
| A: Molecular formula of (2E,4E)-5-[4-(N,N-dimethylamino)phenyl]penta-2,4-dienal is C13H15NO. |
| Q: What is the SMILES notation of (2E,4E)-5-[4-(N,N-dimethylamino)phenyl]penta-2,4-dienal? |
| A: SMILES notation of (2E,4E)-5-[4-(N,N-dimethylamino)phenyl]penta-2,4-dienal is CN(C)c1ccc(C=CC=CC=O)cc1. |
| Q: What is the CAS number of (2E,4E)-5-[4-(N,N-dimethylamino)phenyl]penta-2,4-dienal? |
| A: CAS number of (2E,4E)-5-[4-(N,N-dimethylamino)phenyl]penta-2,4-dienal is 20432-36-4. |
| Q: What is the polar surface area (PSA) of (2E,4E)-5-[4-(N,N-dimethylamino)phenyl]penta-2,4-dienal? |
| A: Polar surface area (PSA) of (2E,4E)-5-[4-(N,N-dimethylamino)phenyl]penta-2,4-dienal is 20.31000. |
| Q: What is the English name of (2E,4E)-5-[4-(N,N-dimethylamino)phenyl]penta-2,4-dienal? |
| A: The English name of (2E,4E)-5-[4-(N,N-dimethylamino)phenyl]penta-2,4-dienal is (2E,4E)-5-[4-(N,N-dimethylamino)phenyl]penta-2,4-dienal. |
| Q: What English synonyms does (2E,4E)-5-[4-(N,N-dimethylamino)phenyl]penta-2,4-dienal have? |
| A: English synonyms of (2E,4E)-5-[4-(N,N-dimethylamino)phenyl]penta-2,4-dienal: (2E,4E)-5-(4-Dimethylamino-phenyl)-penta-2,4-dienal, (2E,4E)-5-(4-(dimethylamino)phenyl)penta-2,4-dienal, 5-(4'-N,N-dimethylaminophenyl)-2,4-pentadienal, 5-(4-N,N-dimethylaminophenyl)penta-2,4-dienal, 5-(4-(N,N-dimethylamino)phenyl)-2,4-pentadienal, (E,E)-5-(4-(Dimethylamino)phenyl)-2,4-pentadienal, (2E,4E)-5-[4-(dimethylamino)phenyl]penta-2,4-dienal. |
| Q: What is the molecular weight of (2E,4E)-5-[4-(N,N-dimethylamino)phenyl]penta-2,4-dienal? |
| A: Molecular weight of (2E,4E)-5-[4-(N,N-dimethylamino)phenyl]penta-2,4-dienal is 201.26400. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |