4-(((tert-Butyldimethylsilyl)oxy)methyl)piperidine
4-(((tert-Butyldimethylsilyl)oxy)methyl)piperidine structure
|
Common Name | 4-(((tert-Butyldimethylsilyl)oxy)methyl)piperidine | ||
|---|---|---|---|---|
| CAS Number | 204580-41-6 | Molecular Weight | 229.43400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H27NOSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | tert-butyl-dimethyl-(piperidin-4-ylmethoxy)silane |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H27NOSi |
|---|---|
| Molecular Weight | 229.43400 |
| Exact Mass | 229.18600 |
| PSA | 21.26000 |
| LogP | 3.33660 |
| InChIKey | CCMAPYHFGQTFQL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OCC1CCNCC1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~52%
4-(((tert-Butyl... CAS#:204580-41-6 |
| Literature: Migulin, Vasily A.; Krayushkin, Michael M.; Barachevsky, Valery A.; Kobeleva, Olga I.; Valova, Tatyana M.; Lyssenko, Konstantin A. Journal of Organic Chemistry, 2012 , vol. 77, # 1 p. 332 - 340 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of tert-butyl-dimethyl-(piperidin-4-ylmethoxy)silane? |
| A: InChIKey of tert-butyl-dimethyl-(piperidin-4-ylmethoxy)silane is CCMAPYHFGQTFQL-UHFFFAOYSA-N. |
| Q: What is the CAS number of tert-butyl-dimethyl-(piperidin-4-ylmethoxy)silane? |
| A: CAS number of tert-butyl-dimethyl-(piperidin-4-ylmethoxy)silane is 204580-41-6. |
| Q: What are the upstream materials of tert-butyl-dimethyl-(piperidin-4-ylmethoxy)silane? |
| A: Related upstream materials(CAS) of tert-butyl-dimethyl-(piperidin-4-ylmethoxy)silane: 6457-49-4;18162-48-6. |
| Q: What is the molecular weight of tert-butyl-dimethyl-(piperidin-4-ylmethoxy)silane? |
| A: Molecular weight of tert-butyl-dimethyl-(piperidin-4-ylmethoxy)silane is 229.43400. |
| Q: What is the English name of tert-butyl-dimethyl-(piperidin-4-ylmethoxy)silane? |
| A: The English name of tert-butyl-dimethyl-(piperidin-4-ylmethoxy)silane is tert-butyl-dimethyl-(piperidin-4-ylmethoxy)silane. |
| Q: What is the molecular formula of tert-butyl-dimethyl-(piperidin-4-ylmethoxy)silane? |
| A: Molecular formula of tert-butyl-dimethyl-(piperidin-4-ylmethoxy)silane is C12H27NOSi. |
| Q: What is the polar surface area (PSA) of tert-butyl-dimethyl-(piperidin-4-ylmethoxy)silane? |
| A: Polar surface area (PSA) of tert-butyl-dimethyl-(piperidin-4-ylmethoxy)silane is 21.26000. |
| Q: What is the SMILES notation of tert-butyl-dimethyl-(piperidin-4-ylmethoxy)silane? |
| A: SMILES notation of tert-butyl-dimethyl-(piperidin-4-ylmethoxy)silane is CC(C)(C)[Si](C)(C)OCC1CCNCC1. |
| Q: What is the LogP of tert-butyl-dimethyl-(piperidin-4-ylmethoxy)silane? |
| A: LogP of tert-butyl-dimethyl-(piperidin-4-ylmethoxy)silane is 3.33660. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |