2-(4-pyridinyl)-4-thiazolecarboxylic acid ethyl ester
2-(4-pyridinyl)-4-thiazolecarboxylic acid ethyl ester structure
|
Common Name | 2-(4-pyridinyl)-4-thiazolecarboxylic acid ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 21278-85-3 | Molecular Weight | 234.27400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H10N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | ethyl 2-pyridin-4-yl-1,3-thiazole-4-carboxylate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H10N2O2S |
|---|---|
| Molecular Weight | 234.27400 |
| Exact Mass | 234.04600 |
| PSA | 80.32000 |
| LogP | 2.38180 |
| InChIKey | YHHRVJSNZLHEPG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1csc(-c2ccncc2)n1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| HMS557I01 |
| 2-pyridin-4-yl-thiazole-4-carboxylic acid ethyl ester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of ethyl 2-pyridin-4-yl-1,3-thiazole-4-carboxylate? |
| A: The English name of ethyl 2-pyridin-4-yl-1,3-thiazole-4-carboxylate is ethyl 2-pyridin-4-yl-1,3-thiazole-4-carboxylate. |
| Q: What is the molecular weight of ethyl 2-pyridin-4-yl-1,3-thiazole-4-carboxylate? |
| A: Molecular weight of ethyl 2-pyridin-4-yl-1,3-thiazole-4-carboxylate is 234.27400. |
| Q: What is the LogP of ethyl 2-pyridin-4-yl-1,3-thiazole-4-carboxylate? |
| A: LogP of ethyl 2-pyridin-4-yl-1,3-thiazole-4-carboxylate is 2.38180. |
| Q: What is the CAS number of ethyl 2-pyridin-4-yl-1,3-thiazole-4-carboxylate? |
| A: CAS number of ethyl 2-pyridin-4-yl-1,3-thiazole-4-carboxylate is 21278-85-3. |
| Q: What is the SMILES notation of ethyl 2-pyridin-4-yl-1,3-thiazole-4-carboxylate? |
| A: SMILES notation of ethyl 2-pyridin-4-yl-1,3-thiazole-4-carboxylate is CCOC(=O)c1csc(-c2ccncc2)n1. |
| Q: What is the InChIKey of ethyl 2-pyridin-4-yl-1,3-thiazole-4-carboxylate? |
| A: InChIKey of ethyl 2-pyridin-4-yl-1,3-thiazole-4-carboxylate is YHHRVJSNZLHEPG-UHFFFAOYSA-N. |
| Q: What is the molecular formula of ethyl 2-pyridin-4-yl-1,3-thiazole-4-carboxylate? |
| A: Molecular formula of ethyl 2-pyridin-4-yl-1,3-thiazole-4-carboxylate is C11H10N2O2S. |
| Q: What English synonyms does ethyl 2-pyridin-4-yl-1,3-thiazole-4-carboxylate have? |
| A: English synonyms of ethyl 2-pyridin-4-yl-1,3-thiazole-4-carboxylate: HMS557I01, 2-pyridin-4-yl-thiazole-4-carboxylic acid ethyl ester. |
| Q: What is the polar surface area (PSA) of ethyl 2-pyridin-4-yl-1,3-thiazole-4-carboxylate? |
| A: Polar surface area (PSA) of ethyl 2-pyridin-4-yl-1,3-thiazole-4-carboxylate is 80.32000. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |