Ethyl (Z)-3-(4-Chlorophenyl)-2-cyanoacrylate
Ethyl (Z)-3-(4-Chlorophenyl)-2-cyanoacrylate structure
|
Common Name | Ethyl (Z)-3-(4-Chlorophenyl)-2-cyanoacrylate | ||
|---|---|---|---|---|
| CAS Number | 2169-68-8 | Molecular Weight | 235.66600 | |
| Density | 1.249g/cm3 | Boiling Point | 367.9ºC at 760mmHg | |
| Molecular Formula | C12H10ClNO2 | Melting Point | 88-90ºC | |
| MSDS | N/A | Flash Point | 176.3ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Ethyl 3-(4-chlorophenyl)-2-cyanoacrylate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.249g/cm3 |
|---|---|
| Boiling Point | 367.9ºC at 760mmHg |
| Melting Point | 88-90ºC |
| Molecular Formula | C12H10ClNO2 |
| Molecular Weight | 235.66600 |
| Flash Point | 176.3ºC |
| Exact Mass | 235.04000 |
| PSA | 50.09000 |
| LogP | 2.81008 |
| Vapour Pressure | 1.32E-05mmHg at 25°C |
| Index of Refraction | 1.576 |
| InChIKey | KLUDCHZOLVGLQF-JXMROGBWSA-N |
| SMILES | CCOC(=O)C(C#N)=Cc1ccc(Cl)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~99%
Ethyl (Z)-3-(4-... CAS#:2169-68-8 |
| Literature: Oskooie, Hossein A.; Roomizadeh, Elham; Heravi, Majid M. Journal of Chemical Research, 2006 , # 4 p. 246 - 247 |
|
~89%
Ethyl (Z)-3-(4-... CAS#:2169-68-8 |
| Literature: Shen, Yanchang; Yang, Baozhen Synthetic Communications, 1989 , vol. 19, # 17 p. 3069 - 3076 |
|
~%
Ethyl (Z)-3-(4-... CAS#:2169-68-8 |
| Literature: Chemische Berichte, , vol. 110, p. 86 - 95 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 5 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| (E)-2-cyano-3-(4-chlorophenyl)-2-propenoic acid ethyl ester |
| RARECHEM AK ML 0352 |
| ethyl 3-(4-chlorophenyl)-2-cyano-prop-2-enoate |
| ethyl (E)-3-(4-chlorophenyl)-2-cyano-2-propenoate |
| ethyl (E)-2-cyano-3-(4-chlorophenyl)-2-acrylate |
| (2E)-3-(4-chlorophenyl)-2-cyano-2-propenoic acid ethyl ester |
| BUTTPARK 486-50 |
| Ethyl (Z)-3-(4-Chlorophenyl)-2-cyanoacrylate |
| ethyl(E)-2-cyano-3-(4-chlorophenyl)-2-propenoate |
| ethyl (2E)-3-(4-chlorophenyl)-2-cyano-2-propenoate |
| 3-(4-chlorophenyl)-2-cyano-acrylic acid ethyl ester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of Ethyl 3-(4-chlorophenyl)-2-cyanoacrylate? |
| A: SMILES notation of Ethyl 3-(4-chlorophenyl)-2-cyanoacrylate is CCOC(=O)C(C#N)=Cc1ccc(Cl)cc1. |
| Q: What is the polar surface area (PSA) of Ethyl 3-(4-chlorophenyl)-2-cyanoacrylate? |
| A: Polar surface area (PSA) of Ethyl 3-(4-chlorophenyl)-2-cyanoacrylate is 50.09000. |
| Q: What are the upstream materials of Ethyl 3-(4-chlorophenyl)-2-cyanoacrylate? |
| A: Related upstream materials(CAS) of Ethyl 3-(4-chlorophenyl)-2-cyanoacrylate: 104-88-1;105-56-6;1187-46-8;62309-98-2;108-90-7. |
| Q: What is the English name of Ethyl 3-(4-chlorophenyl)-2-cyanoacrylate? |
| A: The English name of Ethyl 3-(4-chlorophenyl)-2-cyanoacrylate is Ethyl 3-(4-chlorophenyl)-2-cyanoacrylate. |
| Q: What is the molecular formula of Ethyl 3-(4-chlorophenyl)-2-cyanoacrylate? |
| A: Molecular formula of Ethyl 3-(4-chlorophenyl)-2-cyanoacrylate is C12H10ClNO2. |
| Q: What is the melting point of Ethyl 3-(4-chlorophenyl)-2-cyanoacrylate? |
| A: Melting point of Ethyl 3-(4-chlorophenyl)-2-cyanoacrylate is 88-90ºC. |
| Q: What is the molecular weight of Ethyl 3-(4-chlorophenyl)-2-cyanoacrylate? |
| A: Molecular weight of Ethyl 3-(4-chlorophenyl)-2-cyanoacrylate is 235.66600. |
| Q: What is the boiling point of Ethyl 3-(4-chlorophenyl)-2-cyanoacrylate? |
| A: Boiling point of Ethyl 3-(4-chlorophenyl)-2-cyanoacrylate is 367.9ºC at 760mmHg. |
| Q: What is the CAS number of Ethyl 3-(4-chlorophenyl)-2-cyanoacrylate? |
| A: CAS number of Ethyl 3-(4-chlorophenyl)-2-cyanoacrylate is 2169-68-8. |
| Q: What is the LogP of Ethyl 3-(4-chlorophenyl)-2-cyanoacrylate? |
| A: LogP of Ethyl 3-(4-chlorophenyl)-2-cyanoacrylate is 2.81008. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |