6-(4-FLUOROPHENYL)NICOTINIC ACID
6-(4-FLUOROPHENYL)NICOTINIC ACID structure
|
Common Name | 6-(4-FLUOROPHENYL)NICOTINIC ACID | ||
|---|---|---|---|---|
| CAS Number | 223127-24-0 | Molecular Weight | 217.19600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H8FNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6-(4-fluorophenyl)pyridine-3-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H8FNO2 |
|---|---|
| Molecular Weight | 217.19600 |
| Exact Mass | 217.05400 |
| PSA | 50.19000 |
| LogP | 2.58590 |
| InChIKey | LJIXMNTVEKBCRG-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(-c2ccc(F)cc2)nc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~35%
6-(4-FLUOROPHEN... CAS#:223127-24-0 |
| Literature: ELI LILLY AND COMPANY Patent: WO2004/94382 A1, 2004 ; Location in patent: Page 21 ; WO 2004/094382 A1 |
|
~%
6-(4-FLUOROPHEN... CAS#:223127-24-0 |
| Literature: BANYU PHARMACEUTICAL CO., LTD. Patent: EP1657242 A1, 2006 ; Location in patent: Page/Page column 31 ; |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 6-(4-Fluorophenyl)nicotinic acid |
| 6-(4-fluorophenyl)-pyridine-3-carboxylic acid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does 6-(4-fluorophenyl)pyridine-3-carboxylic acid have? |
| A: English synonyms of 6-(4-fluorophenyl)pyridine-3-carboxylic acid: 6-(4-Fluorophenyl)nicotinic acid, 6-(4-fluorophenyl)-pyridine-3-carboxylic acid. |
| Q: What are the upstream materials of 6-(4-fluorophenyl)pyridine-3-carboxylic acid? |
| A: Related upstream materials(CAS) of 6-(4-fluorophenyl)pyridine-3-carboxylic acid: 149500-84-5;5326-23-8;1765-93-1. |
| Q: What is the SMILES notation of 6-(4-fluorophenyl)pyridine-3-carboxylic acid? |
| A: SMILES notation of 6-(4-fluorophenyl)pyridine-3-carboxylic acid is O=C(O)c1ccc(-c2ccc(F)cc2)nc1. |
| Q: What is the English name of 6-(4-fluorophenyl)pyridine-3-carboxylic acid? |
| A: The English name of 6-(4-fluorophenyl)pyridine-3-carboxylic acid is 6-(4-fluorophenyl)pyridine-3-carboxylic acid. |
| Q: What is the LogP of 6-(4-fluorophenyl)pyridine-3-carboxylic acid? |
| A: LogP of 6-(4-fluorophenyl)pyridine-3-carboxylic acid is 2.58590. |
| Q: What is the CAS number of 6-(4-fluorophenyl)pyridine-3-carboxylic acid? |
| A: CAS number of 6-(4-fluorophenyl)pyridine-3-carboxylic acid is 223127-24-0. |
| Q: What is the molecular weight of 6-(4-fluorophenyl)pyridine-3-carboxylic acid? |
| A: Molecular weight of 6-(4-fluorophenyl)pyridine-3-carboxylic acid is 217.19600. |
| Q: What is the InChIKey of 6-(4-fluorophenyl)pyridine-3-carboxylic acid? |
| A: InChIKey of 6-(4-fluorophenyl)pyridine-3-carboxylic acid is LJIXMNTVEKBCRG-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of 6-(4-fluorophenyl)pyridine-3-carboxylic acid? |
| A: Polar surface area (PSA) of 6-(4-fluorophenyl)pyridine-3-carboxylic acid is 50.19000. |
| Q: What is the molecular formula of 6-(4-fluorophenyl)pyridine-3-carboxylic acid? |
| A: Molecular formula of 6-(4-fluorophenyl)pyridine-3-carboxylic acid is C12H8FNO2. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |