3-(2,4-Dioxotetrahydropyrimidin-1(2H)-YL)-4-methylbenzoic acid
Modify Date: 2025-09-11 16:19:21
3-(2,4-Dioxotetrahydropyrimidin-1(2H)-YL)-4-methylbenzoic acid structure
|
Common Name | 3-(2,4-Dioxotetrahydropyrimidin-1(2H)-YL)-4-methylbenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 2377643-37-1 | Molecular Weight | 248.23 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H12N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(2,4-Dioxotetrahydropyrimidin-1(2H)-YL)-4-methylbenzoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H12N2O4 |
|---|---|
| Molecular Weight | 248.23 |
| InChIKey | NXRZIUASGSMTJJ-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(=O)O)cc1N1CCC(=O)NC1=O |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: PROTAC activity at CBRN/BRD4 in human HEK293T cells assessed as degradation of BRD4 a...
Source: ChEMBL
Target: Protein cereblon
External Id: CHEMBL5125631
|
|
Name: Cytotoxicity against human HEK293 cells assessed as inhibition of cell viability at 2...
Source: ChEMBL
Target: HEK293
External Id: CHEMBL5125633
|
Total 2, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 3-(2,4-Dioxotetrahydropyrimidin-1(2H)-YL)-4-methylbenzoic acid? |
| A: SMILES notation of 3-(2,4-Dioxotetrahydropyrimidin-1(2H)-YL)-4-methylbenzoic acid is Cc1ccc(C(=O)O)cc1N1CCC(=O)NC1=O. |
| Q: What is the InChIKey of 3-(2,4-Dioxotetrahydropyrimidin-1(2H)-YL)-4-methylbenzoic acid? |
| A: InChIKey of 3-(2,4-Dioxotetrahydropyrimidin-1(2H)-YL)-4-methylbenzoic acid is NXRZIUASGSMTJJ-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 3-(2,4-Dioxotetrahydropyrimidin-1(2H)-YL)-4-methylbenzoic acid? |
| A: Molecular weight of 3-(2,4-Dioxotetrahydropyrimidin-1(2H)-YL)-4-methylbenzoic acid is 248.23. |
| Q: What is the English name of 3-(2,4-Dioxotetrahydropyrimidin-1(2H)-YL)-4-methylbenzoic acid? |
| A: The English name of 3-(2,4-Dioxotetrahydropyrimidin-1(2H)-YL)-4-methylbenzoic acid is 3-(2,4-Dioxotetrahydropyrimidin-1(2H)-YL)-4-methylbenzoic acid. |
| Q: What is the CAS number of 3-(2,4-Dioxotetrahydropyrimidin-1(2H)-YL)-4-methylbenzoic acid? |
| A: CAS number of 3-(2,4-Dioxotetrahydropyrimidin-1(2H)-YL)-4-methylbenzoic acid is 2377643-37-1. |
| Q: What is the Chinese name of 2377643-37-1? |
| A: Chinese name of 2377643-37-1 is 2377643-37-1. |
| Q: What is the molecular formula of 3-(2,4-Dioxotetrahydropyrimidin-1(2H)-YL)-4-methylbenzoic acid? |
| A: Molecular formula of 3-(2,4-Dioxotetrahydropyrimidin-1(2H)-YL)-4-methylbenzoic acid is C12H12N2O4. |