4-(methoxycarbonyl)-3,5-dichlorobenzoic acid
4-(methoxycarbonyl)-3,5-dichlorobenzoic acid structure
|
Common Name | 4-(methoxycarbonyl)-3,5-dichlorobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 264272-64-2 | Molecular Weight | 249.048 | |
| Density | 1.5±0.0 g/cm3 | Boiling Point | 383.0±0.0 °C at 760 mmHg | |
| Molecular Formula | C9H6Cl2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 185.4±0.0 °C | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3,5-Dichloro-4-(methoxycarbonyl)benzoic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.5±0.0 g/cm3 |
|---|---|
| Boiling Point | 383.0±0.0 °C at 760 mmHg |
| Molecular Formula | C9H6Cl2O4 |
| Molecular Weight | 249.048 |
| Flash Point | 185.4±0.0 °C |
| Exact Mass | 247.964310 |
| LogP | 3.71 |
| Vapour Pressure | 0.0±0.0 mmHg at 25°C |
| Index of Refraction | 1.583 |
| InChIKey | HEPDHTNDZDMUBB-UHFFFAOYSA-N |
| SMILES | COC(=O)c1c(Cl)cc(C(=O)O)cc1Cl |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3,5-Dichloro-4-(methoxycarbonyl)benzoic acid |
| 1,4-Benzenedicarboxylic acid, 2,6-dichloro-, 1-methyl ester |
| MFCD21605283 |
| 1-Methyl 2,6-dichloro-1,4-benzenedicarboxylate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 3,5-Dichloro-4-(methoxycarbonyl)benzoic acid? |
| A: LogP of 3,5-Dichloro-4-(methoxycarbonyl)benzoic acid is 3.71. |
| Q: What is the boiling point of 3,5-Dichloro-4-(methoxycarbonyl)benzoic acid? |
| A: Boiling point of 3,5-Dichloro-4-(methoxycarbonyl)benzoic acid is 383.0±0.0 °C at 760 mmHg. |
| Q: What is the Chinese name of 264272-64-2? |
| A: Chinese name of 264272-64-2 is 264272-64-2. |
| Q: What is the molecular weight of 3,5-Dichloro-4-(methoxycarbonyl)benzoic acid? |
| A: Molecular weight of 3,5-Dichloro-4-(methoxycarbonyl)benzoic acid is 249.048. |
| Q: What is the English name of 3,5-Dichloro-4-(methoxycarbonyl)benzoic acid? |
| A: The English name of 3,5-Dichloro-4-(methoxycarbonyl)benzoic acid is 3,5-Dichloro-4-(methoxycarbonyl)benzoic acid. |
| Q: What is the SMILES notation of 3,5-Dichloro-4-(methoxycarbonyl)benzoic acid? |
| A: SMILES notation of 3,5-Dichloro-4-(methoxycarbonyl)benzoic acid is COC(=O)c1c(Cl)cc(C(=O)O)cc1Cl. |
| Q: What is the CAS number of 3,5-Dichloro-4-(methoxycarbonyl)benzoic acid? |
| A: CAS number of 3,5-Dichloro-4-(methoxycarbonyl)benzoic acid is 264272-64-2. |
| Q: What is the molecular formula of 3,5-Dichloro-4-(methoxycarbonyl)benzoic acid? |
| A: Molecular formula of 3,5-Dichloro-4-(methoxycarbonyl)benzoic acid is C9H6Cl2O4. |
| Q: What English synonyms does 3,5-Dichloro-4-(methoxycarbonyl)benzoic acid have? |
| A: English synonyms of 3,5-Dichloro-4-(methoxycarbonyl)benzoic acid: 3,5-Dichloro-4-(methoxycarbonyl)benzoic acid, 1,4-Benzenedicarboxylic acid, 2,6-dichloro-, 1-methyl ester, MFCD21605283, 1-Methyl 2,6-dichloro-1,4-benzenedicarboxylate. |
| Q: What is the InChIKey of 3,5-Dichloro-4-(methoxycarbonyl)benzoic acid? |
| A: InChIKey of 3,5-Dichloro-4-(methoxycarbonyl)benzoic acid is HEPDHTNDZDMUBB-UHFFFAOYSA-N. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |