1,1'-BIPHENYL]-2-SULFONYL CHLORIDE
![1,1'-BIPHENYL]-2-SULFONYL CHLORIDE Structure](https://image.chemsrc.com/caspic/293/2688-90-6.png)
1,1'-BIPHENYL]-2-SULFONYL CHLORIDE structure
|
Common Name | 1,1'-BIPHENYL]-2-SULFONYL CHLORIDE | ||
|---|---|---|---|---|
| CAS Number | 2688-90-6 | Molecular Weight | 252.71700 | |
| Density | 1.32g/cm3 | Boiling Point | 391.6ºC at 760 mmHg | |
| Molecular Formula | C12H9ClO2S | Melting Point | N/A | |
| MSDS | USA | Flash Point | 190.7ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-phenylbenzenesulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.32g/cm3 |
|---|---|
| Boiling Point | 391.6ºC at 760 mmHg |
| Molecular Formula | C12H9ClO2S |
| Molecular Weight | 252.71700 |
| Flash Point | 190.7ºC |
| Exact Mass | 252.00100 |
| PSA | 42.52000 |
| LogP | 4.36190 |
| Vapour Pressure | 5.48E-06mmHg at 25°C |
| Index of Refraction | 1.595 |
| InChIKey | RENKNADFNRIRNZ-UHFFFAOYSA-N |
| SMILES | O=S(=O)(Cl)c1ccccc1-c1ccccc1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2904909090 |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~65%
1,1'-BIPHENYL]-... CAS#:2688-90-6 |
| Literature: Wyeth Patent: US2003/144282 A1, 2003 ; |
|
~%
1,1'-BIPHENYL]-... CAS#:2688-90-6 |
| Literature: Bristol-Myers Squibb Co. Patent: US5514696 A1, 1996 ; US 5514696 A |
|
~49%
1,1'-BIPHENYL]-... CAS#:2688-90-6 |
| Literature: Texas Biotechnology Corporation Patent: US5571821 A1, 1996 ; US 5571821 A |
|
~%
1,1'-BIPHENYL]-... CAS#:2688-90-6 |
| Literature: Bristol-Myers Squibb Co. Patent: US5514696 A1, 1996 ; US 5514696 A |
|
~%
1,1'-BIPHENYL]-... CAS#:2688-90-6 |
| Literature: Glover, Stephen A.; Goosen, Andre; McCleland, Cedric W.; Schoonraad, Johan L. Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1986 , p. 645 - 654 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 5 | |
|---|---|
| DownStream 3 | |
CAS#:19813-97-9
CAS#:62533-08-8
CAS#:40182-06-7This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-phenylbenzenesulphonyl chloride |
| Biphenyl-2-sulfonylchlorid |
| 2-biphenylsulphonyl chloride |
| 1,1'-biphenyl-2-sulfonyl chloride |
| [1,1'-biphenyl]-2-sulphonyl chloride |
| 2-biphenylsulfonyl chloride |
| Biphenyl-2-sulfonyl chloride |
| Biphenyl-2-sulphonyl chloride |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 2-phenylbenzenesulfonyl chloride? |
| A: Molecular formula of 2-phenylbenzenesulfonyl chloride is C12H9ClO2S. |
| Q: What is the SMILES notation of 2-phenylbenzenesulfonyl chloride? |
| A: SMILES notation of 2-phenylbenzenesulfonyl chloride is O=S(=O)(Cl)c1ccccc1-c1ccccc1. |
| Q: What English synonyms does 2-phenylbenzenesulfonyl chloride have? |
| A: English synonyms of 2-phenylbenzenesulfonyl chloride: 2-phenylbenzenesulphonyl chloride, Biphenyl-2-sulfonylchlorid, 2-biphenylsulphonyl chloride, 1,1'-biphenyl-2-sulfonyl chloride, [1,1'-biphenyl]-2-sulphonyl chloride, 2-biphenylsulfonyl chloride, Biphenyl-2-sulfonyl chloride, Biphenyl-2-sulphonyl chloride. |
| Q: What is the CAS number of 2-phenylbenzenesulfonyl chloride? |
| A: CAS number of 2-phenylbenzenesulfonyl chloride is 2688-90-6. |
| Q: What is the polar surface area (PSA) of 2-phenylbenzenesulfonyl chloride? |
| A: Polar surface area (PSA) of 2-phenylbenzenesulfonyl chloride is 42.52000. |
| Q: What is the molecular weight of 2-phenylbenzenesulfonyl chloride? |
| A: Molecular weight of 2-phenylbenzenesulfonyl chloride is 252.71700. |
| Q: What is the LogP of 2-phenylbenzenesulfonyl chloride? |
| A: LogP of 2-phenylbenzenesulfonyl chloride is 4.36190. |
| Q: What are the upstream materials of 2-phenylbenzenesulfonyl chloride? |
| A: Related upstream materials(CAS) of 2-phenylbenzenesulfonyl chloride: 2052-07-5;90-41-5;109-72-8;2688-84-8;2113-51-1. |
| Q: What are the downstream products of 2-phenylbenzenesulfonyl chloride? |
| A: Related downstream products(CAS) of 2-phenylbenzenesulfonyl chloride: 19813-97-9;62533-08-8;40182-06-7. |
| Q: What is the English name of 2-phenylbenzenesulfonyl chloride? |
| A: The English name of 2-phenylbenzenesulfonyl chloride is 2-phenylbenzenesulfonyl chloride. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |