1-Tert-Butyl 5-Methyl Indoline-1,5-Dicarboxylate
1-Tert-Butyl 5-Methyl Indoline-1,5-Dicarboxylate structure
|
Common Name | 1-Tert-Butyl 5-Methyl Indoline-1,5-Dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 272438-12-7 | Molecular Weight | 277.31600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H19NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,3-dihydro-indole-1,5-dicarboxylic acid 1-tert-butyl ester 5-methyl ester |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H19NO4 |
|---|---|
| Molecular Weight | 277.31600 |
| Exact Mass | 277.13100 |
| PSA | 55.84000 |
| LogP | 2.83580 |
| InChIKey | KANVSPBCQYQXFC-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc2c(c1)CCN2C(=O)OC(C)(C)C |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
![1-[(TERT-BUTOXY)CARBONYL]-2,3-DIHYDRO-1H-INDOLE-5-CARBOXYLIC ACID structure](https://image.chemsrc.com/caspic/450/339007-88-4.png)
CAS#:339007-88-4This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1-(tert-butoxycarbonyl)-5-methoxycarbonylindoline |
| tert-butyl 5-methyl 1,5-indolinedicarboxylate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 2,3-dihydro-indole-1,5-dicarboxylic acid 1-tert-butyl ester 5-methyl ester? |
| A: Molecular weight of 2,3-dihydro-indole-1,5-dicarboxylic acid 1-tert-butyl ester 5-methyl ester is 277.31600. |
| Q: What are the downstream products of 2,3-dihydro-indole-1,5-dicarboxylic acid 1-tert-butyl ester 5-methyl ester? |
| A: Related downstream products(CAS) of 2,3-dihydro-indole-1,5-dicarboxylic acid 1-tert-butyl ester 5-methyl ester: 339007-88-4. |
| Q: What is the LogP of 2,3-dihydro-indole-1,5-dicarboxylic acid 1-tert-butyl ester 5-methyl ester? |
| A: LogP of 2,3-dihydro-indole-1,5-dicarboxylic acid 1-tert-butyl ester 5-methyl ester is 2.83580. |
| Q: What is the polar surface area (PSA) of 2,3-dihydro-indole-1,5-dicarboxylic acid 1-tert-butyl ester 5-methyl ester? |
| A: Polar surface area (PSA) of 2,3-dihydro-indole-1,5-dicarboxylic acid 1-tert-butyl ester 5-methyl ester is 55.84000. |
| Q: What is the InChIKey of 2,3-dihydro-indole-1,5-dicarboxylic acid 1-tert-butyl ester 5-methyl ester? |
| A: InChIKey of 2,3-dihydro-indole-1,5-dicarboxylic acid 1-tert-butyl ester 5-methyl ester is KANVSPBCQYQXFC-UHFFFAOYSA-N. |
| Q: What is the CAS number of 2,3-dihydro-indole-1,5-dicarboxylic acid 1-tert-butyl ester 5-methyl ester? |
| A: CAS number of 2,3-dihydro-indole-1,5-dicarboxylic acid 1-tert-butyl ester 5-methyl ester is 272438-12-7. |
| Q: What is the English name of 2,3-dihydro-indole-1,5-dicarboxylic acid 1-tert-butyl ester 5-methyl ester? |
| A: The English name of 2,3-dihydro-indole-1,5-dicarboxylic acid 1-tert-butyl ester 5-methyl ester is 2,3-dihydro-indole-1,5-dicarboxylic acid 1-tert-butyl ester 5-methyl ester. |
| Q: What English synonyms does 2,3-dihydro-indole-1,5-dicarboxylic acid 1-tert-butyl ester 5-methyl ester have? |
| A: English synonyms of 2,3-dihydro-indole-1,5-dicarboxylic acid 1-tert-butyl ester 5-methyl ester: 1-(tert-butoxycarbonyl)-5-methoxycarbonylindoline, tert-butyl 5-methyl 1,5-indolinedicarboxylate. |
| Q: What is the SMILES notation of 2,3-dihydro-indole-1,5-dicarboxylic acid 1-tert-butyl ester 5-methyl ester? |
| A: SMILES notation of 2,3-dihydro-indole-1,5-dicarboxylic acid 1-tert-butyl ester 5-methyl ester is COC(=O)c1ccc2c(c1)CCN2C(=O)OC(C)(C)C. |
| Q: What is the molecular formula of 2,3-dihydro-indole-1,5-dicarboxylic acid 1-tert-butyl ester 5-methyl ester? |
| A: Molecular formula of 2,3-dihydro-indole-1,5-dicarboxylic acid 1-tert-butyl ester 5-methyl ester is C15H19NO4. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |