4-(4-bromophenyl)-3,6-dihydro-2H-pyridine-1-carboxylic acid tert-butyl ester
4-(4-bromophenyl)-3,6-dihydro-2H-pyridine-1-carboxylic acid tert-butyl ester structure
|
Common Name | 4-(4-bromophenyl)-3,6-dihydro-2H-pyridine-1-carboxylic acid tert-butyl ester | ||
|---|---|---|---|---|
| CAS Number | 273727-44-9 | Molecular Weight | 338.24000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H20BrNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-(4-bromophenyl)-3,6-dihydro-2H-pyridine-1-carboxylic acid tert-butyl ester |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H20BrNO2 |
|---|---|
| Molecular Weight | 338.24000 |
| Exact Mass | 337.06800 |
| PSA | 29.54000 |
| LogP | 4.41120 |
| InChIKey | UTTKOPGVQIWTCJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC=C(c2ccc(Br)cc2)CC1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:91347-99-8This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| tert-butyl 4-(4-bromo-phenyl)-3,6-dihydropyridine-1(2H)-carboxylate |
| 4-(4-bromo-phenyl)-3,6-dihydro-2H-pyridine-1-carboxylic acid tert-butyl ester |
| tert-butyl 4-(4-bromophenyl)-3,6-dihydropyridine-1(2H)-carboxylate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 4-(4-bromophenyl)-3,6-dihydro-2H-pyridine-1-carboxylic acid tert-butyl ester? |
| A: Molecular formula of 4-(4-bromophenyl)-3,6-dihydro-2H-pyridine-1-carboxylic acid tert-butyl ester is C16H20BrNO2. |
| Q: What is the LogP of 4-(4-bromophenyl)-3,6-dihydro-2H-pyridine-1-carboxylic acid tert-butyl ester? |
| A: LogP of 4-(4-bromophenyl)-3,6-dihydro-2H-pyridine-1-carboxylic acid tert-butyl ester is 4.41120. |
| Q: What is the English name of 4-(4-bromophenyl)-3,6-dihydro-2H-pyridine-1-carboxylic acid tert-butyl ester? |
| A: The English name of 4-(4-bromophenyl)-3,6-dihydro-2H-pyridine-1-carboxylic acid tert-butyl ester is 4-(4-bromophenyl)-3,6-dihydro-2H-pyridine-1-carboxylic acid tert-butyl ester. |
| Q: What is the SMILES notation of 4-(4-bromophenyl)-3,6-dihydro-2H-pyridine-1-carboxylic acid tert-butyl ester? |
| A: SMILES notation of 4-(4-bromophenyl)-3,6-dihydro-2H-pyridine-1-carboxylic acid tert-butyl ester is CC(C)(C)OC(=O)N1CC=C(c2ccc(Br)cc2)CC1. |
| Q: What is the InChIKey of 4-(4-bromophenyl)-3,6-dihydro-2H-pyridine-1-carboxylic acid tert-butyl ester? |
| A: InChIKey of 4-(4-bromophenyl)-3,6-dihydro-2H-pyridine-1-carboxylic acid tert-butyl ester is UTTKOPGVQIWTCJ-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 4-(4-bromophenyl)-3,6-dihydro-2H-pyridine-1-carboxylic acid tert-butyl ester? |
| A: Molecular weight of 4-(4-bromophenyl)-3,6-dihydro-2H-pyridine-1-carboxylic acid tert-butyl ester is 338.24000. |
| Q: What is the polar surface area (PSA) of 4-(4-bromophenyl)-3,6-dihydro-2H-pyridine-1-carboxylic acid tert-butyl ester? |
| A: Polar surface area (PSA) of 4-(4-bromophenyl)-3,6-dihydro-2H-pyridine-1-carboxylic acid tert-butyl ester is 29.54000. |
| Q: What is the Chinese name of 273727-44-9? |
| A: Chinese name of 273727-44-9 is 273727-44-9. |
| Q: What are the downstream products of 4-(4-bromophenyl)-3,6-dihydro-2H-pyridine-1-carboxylic acid tert-butyl ester? |
| A: Related downstream products(CAS) of 4-(4-bromophenyl)-3,6-dihydro-2H-pyridine-1-carboxylic acid tert-butyl ester: 91347-99-8. |
| Q: What is the CAS number of 4-(4-bromophenyl)-3,6-dihydro-2H-pyridine-1-carboxylic acid tert-butyl ester? |
| A: CAS number of 4-(4-bromophenyl)-3,6-dihydro-2H-pyridine-1-carboxylic acid tert-butyl ester is 273727-44-9. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |