2-BENZYL-5-ACETYL METHYL SALICYLATE
2-BENZYL-5-ACETYL METHYL SALICYLATE structure
|
Common Name | 2-BENZYL-5-ACETYL METHYL SALICYLATE | ||
|---|---|---|---|---|
| CAS Number | 27475-09-8 | Molecular Weight | 284.30700 | |
| Density | 1.167g/cm3 | Boiling Point | 443.482ºC at 760 mmHg | |
| Molecular Formula | C17H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 196.816ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | methyl 5-acetyl-2-phenylmethoxybenzoate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.167g/cm3 |
|---|---|
| Boiling Point | 443.482ºC at 760 mmHg |
| Molecular Formula | C17H16O4 |
| Molecular Weight | 284.30700 |
| Flash Point | 196.816ºC |
| Exact Mass | 284.10500 |
| PSA | 52.60000 |
| LogP | 3.25480 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.564 |
| InChIKey | CCBVZNHYLQHOLD-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(C(C)=O)ccc1OCc1ccccc1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2918990090 |
|---|
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 4 | |
CAS#:201663-18-5
CAS#:89365-50-4
CAS#:27475-14-5
CAS#:63416-79-5This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| benzyl ether of methyl 5-acetylsalicylate |
| 2-Benzyloxy-5-acetylbenzoic Acid Methyl Ester |
| 5-acetyl-2-(phenylmethoxy)benzoic acid,methyl ester |
| estere metilico dell'acido 5-acetil-2-benzilossibenzoico |
| Methyl 5-Acetyl-2-(Benzyl-Oxy)Benzoate |
| Y6153 |
| 5-acetyl-2-benzyloxybenzoic acid methyl ester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does methyl 5-acetyl-2-phenylmethoxybenzoate have? |
| A: English synonyms of methyl 5-acetyl-2-phenylmethoxybenzoate: benzyl ether of methyl 5-acetylsalicylate, 2-Benzyloxy-5-acetylbenzoic Acid Methyl Ester, 5-acetyl-2-(phenylmethoxy)benzoic acid,methyl ester, estere metilico dell'acido 5-acetil-2-benzilossibenzoico, Methyl 5-Acetyl-2-(Benzyl-Oxy)Benzoate, Y6153, 5-acetyl-2-benzyloxybenzoic acid methyl ester. |
| Q: What is the boiling point of methyl 5-acetyl-2-phenylmethoxybenzoate? |
| A: Boiling point of methyl 5-acetyl-2-phenylmethoxybenzoate is 443.482ºC at 760 mmHg. |
| Q: What are the downstream products of methyl 5-acetyl-2-phenylmethoxybenzoate? |
| A: Related downstream products(CAS) of methyl 5-acetyl-2-phenylmethoxybenzoate: 201663-18-5;89365-50-4;27475-14-5;63416-79-5. |
| Q: What is the InChIKey of methyl 5-acetyl-2-phenylmethoxybenzoate? |
| A: InChIKey of methyl 5-acetyl-2-phenylmethoxybenzoate is CCBVZNHYLQHOLD-UHFFFAOYSA-N. |
| Q: What is the LogP of methyl 5-acetyl-2-phenylmethoxybenzoate? |
| A: LogP of methyl 5-acetyl-2-phenylmethoxybenzoate is 3.25480. |
| Q: What is the polar surface area (PSA) of methyl 5-acetyl-2-phenylmethoxybenzoate? |
| A: Polar surface area (PSA) of methyl 5-acetyl-2-phenylmethoxybenzoate is 52.60000. |
| Q: What is the CAS number of methyl 5-acetyl-2-phenylmethoxybenzoate? |
| A: CAS number of methyl 5-acetyl-2-phenylmethoxybenzoate is 27475-09-8. |
| Q: What is the molecular formula of methyl 5-acetyl-2-phenylmethoxybenzoate? |
| A: Molecular formula of methyl 5-acetyl-2-phenylmethoxybenzoate is C17H16O4. |
| Q: What is the molecular weight of methyl 5-acetyl-2-phenylmethoxybenzoate? |
| A: Molecular weight of methyl 5-acetyl-2-phenylmethoxybenzoate is 284.30700. |
| Q: What is the SMILES notation of methyl 5-acetyl-2-phenylmethoxybenzoate? |
| A: SMILES notation of methyl 5-acetyl-2-phenylmethoxybenzoate is COC(=O)c1cc(C(C)=O)ccc1OCc1ccccc1. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |