3-(tert-Butyl)benzene-1-sulfonyl chloride
3-(tert-Butyl)benzene-1-sulfonyl chloride structure
|
Common Name | 3-(tert-Butyl)benzene-1-sulfonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 2905-26-2 | Molecular Weight | 232.72700 | |
| Density | 1.207g/cm3 | Boiling Point | 301.9ºC at 760 mmHg | |
| Molecular Formula | C10H13ClO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 136.4ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-tert-Butylbenzenesulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.207g/cm3 |
|---|---|
| Boiling Point | 301.9ºC at 760 mmHg |
| Molecular Formula | C10H13ClO2S |
| Molecular Weight | 232.72700 |
| Flash Point | 136.4ºC |
| Exact Mass | 232.03200 |
| PSA | 42.52000 |
| LogP | 3.99240 |
| Vapour Pressure | 0.00183mmHg at 25°C |
| Index of Refraction | 1.523 |
| InChIKey | WZQSQOIYTVCFMP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1cccc(S(=O)(=O)Cl)c1 |
| Storage condition | 2-8°C |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2904909090 |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
3-(tert-Butyl)b... CAS#:2905-26-2 |
| Literature: Prinsen,A.J.; Cerfontain,H. Recueil des Travaux Chimiques des Pays-Bas, 1965 , vol. 84, p. 24 - 30 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 0 | |
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3-tert-Butylbenzenesulphonyl chloride |
| 3-(1,1-dimethylethyl)benzene-sulphonyl chloride |
| 3-(tert-Butyl)benzene-1-sulfonyl chloride |
| 3-tert-butyl-benzenesulfonyl chloride |
| m-tert.-Butyl-benzolsulfonylchlorid |
| 3-(1,1-dimethylethyl)benzenesulfonyl chloride |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 3-tert-Butylbenzenesulfonyl chloride? |
| A: LogP of 3-tert-Butylbenzenesulfonyl chloride is 3.99240. |
| Q: What is the SMILES notation of 3-tert-Butylbenzenesulfonyl chloride? |
| A: SMILES notation of 3-tert-Butylbenzenesulfonyl chloride is CC(C)(C)c1cccc(S(=O)(=O)Cl)c1. |
| Q: What are the storage conditions for 3-tert-Butylbenzenesulfonyl chloride? |
| A: Storage conditions for 3-tert-Butylbenzenesulfonyl chloride: 2-8°C. |
| Q: What is the boiling point of 3-tert-Butylbenzenesulfonyl chloride? |
| A: Boiling point of 3-tert-Butylbenzenesulfonyl chloride is 301.9ºC at 760 mmHg. |
| Q: What are the upstream materials of 3-tert-Butylbenzenesulfonyl chloride? |
| A: Related upstream materials(CAS) of 3-tert-Butylbenzenesulfonyl chloride: 5369-19-7. |
| Q: What is the molecular formula of 3-tert-Butylbenzenesulfonyl chloride? |
| A: Molecular formula of 3-tert-Butylbenzenesulfonyl chloride is C10H13ClO2S. |
| Q: What English synonyms does 3-tert-Butylbenzenesulfonyl chloride have? |
| A: English synonyms of 3-tert-Butylbenzenesulfonyl chloride: 3-tert-Butylbenzenesulphonyl chloride, 3-(1,1-dimethylethyl)benzene-sulphonyl chloride, 3-(tert-Butyl)benzene-1-sulfonyl chloride, 3-tert-butyl-benzenesulfonyl chloride, m-tert.-Butyl-benzolsulfonylchlorid, 3-(1,1-dimethylethyl)benzenesulfonyl chloride. |
| Q: What is the polar surface area (PSA) of 3-tert-Butylbenzenesulfonyl chloride? |
| A: Polar surface area (PSA) of 3-tert-Butylbenzenesulfonyl chloride is 42.52000. |
| Q: What is the molecular weight of 3-tert-Butylbenzenesulfonyl chloride? |
| A: Molecular weight of 3-tert-Butylbenzenesulfonyl chloride is 232.72700. |
| Q: What is the English name of 3-tert-Butylbenzenesulfonyl chloride? |
| A: The English name of 3-tert-Butylbenzenesulfonyl chloride is 3-tert-Butylbenzenesulfonyl chloride. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |