2,4-Dimethyl-3-nitroaniline
2,4-Dimethyl-3-nitroaniline structure
|
Common Name | 2,4-Dimethyl-3-nitroaniline | ||
|---|---|---|---|---|
| CAS Number | 31167-04-1 | Molecular Weight | 166.17700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H10N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,4-dimethyl-3-nitro-aniline |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H10N2O2 |
|---|---|
| Molecular Weight | 166.17700 |
| Exact Mass | 166.07400 |
| PSA | 71.84000 |
| LogP | 2.89820 |
| InChIKey | MCRYBELDVGNCFW-UHFFFAOYSA-N |
| SMILES | Cc1ccc(N)c(C)c1[N+](=O)[O-] |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3-nitro-2,4-dimethylaniline |
| m-nitrodimethylaniline |
| (2,4-dimethyl-3-nitro-phenyl)amine |
| 2,4-Dimethyl-3-nitro-anilin |
| 2-Nitro-4-amino-m-xylol |
| 2,4-dimethyl-3-nitro-benzenamine |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 2,4-dimethyl-3-nitro-aniline? |
| A: The English name of 2,4-dimethyl-3-nitro-aniline is 2,4-dimethyl-3-nitro-aniline. |
| Q: What is the molecular formula of 2,4-dimethyl-3-nitro-aniline? |
| A: Molecular formula of 2,4-dimethyl-3-nitro-aniline is C8H10N2O2. |
| Q: What is the LogP of 2,4-dimethyl-3-nitro-aniline? |
| A: LogP of 2,4-dimethyl-3-nitro-aniline is 2.89820. |
| Q: What is the SMILES notation of 2,4-dimethyl-3-nitro-aniline? |
| A: SMILES notation of 2,4-dimethyl-3-nitro-aniline is Cc1ccc(N)c(C)c1[N+](=O)[O-]. |
| Q: What is the Chinese name of 31167-04-1? |
| A: Chinese name of 31167-04-1 is 31167-04-1. |
| Q: What is the CAS number of 2,4-dimethyl-3-nitro-aniline? |
| A: CAS number of 2,4-dimethyl-3-nitro-aniline is 31167-04-1. |
| Q: What is the InChIKey of 2,4-dimethyl-3-nitro-aniline? |
| A: InChIKey of 2,4-dimethyl-3-nitro-aniline is MCRYBELDVGNCFW-UHFFFAOYSA-N. |
| Q: What English synonyms does 2,4-dimethyl-3-nitro-aniline have? |
| A: English synonyms of 2,4-dimethyl-3-nitro-aniline: 3-nitro-2,4-dimethylaniline, m-nitrodimethylaniline, (2,4-dimethyl-3-nitro-phenyl)amine, 2,4-Dimethyl-3-nitro-anilin, 2-Nitro-4-amino-m-xylol, 2,4-dimethyl-3-nitro-benzenamine. |
| Q: What is the molecular weight of 2,4-dimethyl-3-nitro-aniline? |
| A: Molecular weight of 2,4-dimethyl-3-nitro-aniline is 166.17700. |
| Q: What is the polar surface area (PSA) of 2,4-dimethyl-3-nitro-aniline? |
| A: Polar surface area (PSA) of 2,4-dimethyl-3-nitro-aniline is 71.84000. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |