4-(5-Fluoro-1H-indol-3-yl)butanoic acid
4-(5-Fluoro-1H-indol-3-yl)butanoic acid structure
|
Common Name | 4-(5-Fluoro-1H-indol-3-yl)butanoic acid | ||
|---|---|---|---|---|
| CAS Number | 319-72-2 | Molecular Weight | 221.228 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 429.6±30.0 °C at 760 mmHg | |
| Molecular Formula | C12H12FNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 213.6±24.6 °C | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-(5-fluoro-1H-indol-3-yl)butanoic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 429.6±30.0 °C at 760 mmHg |
| Molecular Formula | C12H12FNO2 |
| Molecular Weight | 221.228 |
| Flash Point | 213.6±24.6 °C |
| Exact Mass | 221.085205 |
| PSA | 53.09000 |
| LogP | 2.48 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.625 |
| InChIKey | IJAVCLNGRFTCBG-UHFFFAOYSA-N |
| SMILES | O=C(O)CCCc1c[nH]c2ccc(F)cc12 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2933990090 |
|---|
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4-(5-fluoroindol-3-yl)butanoic acid |
| 4-(5-Fluoro-1H-indol-3-yl)-butyric acid |
| 4-(5-fluoro-indol-3-yl)-butyric acid |
| 1H-Indole-3-butanoicacid,5-fluoro |
| 5-fluoro-3-(3-carboxypropyl)-1H-indole |
| MFCD03839847 |
| 5-Fluoroindole-3-butyric acid |
| 4-(5-Fluor-indol-3-yl)-buttersaeure |
| 4-(5-Fluoro-1H-indol-3-yl)butanoic acid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of 4-(5-fluoro-1H-indol-3-yl)butanoic acid? |
| A: Polar surface area (PSA) of 4-(5-fluoro-1H-indol-3-yl)butanoic acid is 53.09000. |
| Q: What is the English name of 4-(5-fluoro-1H-indol-3-yl)butanoic acid? |
| A: The English name of 4-(5-fluoro-1H-indol-3-yl)butanoic acid is 4-(5-fluoro-1H-indol-3-yl)butanoic acid. |
| Q: What is the CAS number of 4-(5-fluoro-1H-indol-3-yl)butanoic acid? |
| A: CAS number of 4-(5-fluoro-1H-indol-3-yl)butanoic acid is 319-72-2. |
| Q: What is the SMILES notation of 4-(5-fluoro-1H-indol-3-yl)butanoic acid? |
| A: SMILES notation of 4-(5-fluoro-1H-indol-3-yl)butanoic acid is O=C(O)CCCc1c[nH]c2ccc(F)cc12. |
| Q: What is the molecular weight of 4-(5-fluoro-1H-indol-3-yl)butanoic acid? |
| A: Molecular weight of 4-(5-fluoro-1H-indol-3-yl)butanoic acid is 221.228. |
| Q: What is the boiling point of 4-(5-fluoro-1H-indol-3-yl)butanoic acid? |
| A: Boiling point of 4-(5-fluoro-1H-indol-3-yl)butanoic acid is 429.6±30.0 °C at 760 mmHg. |
| Q: What is the molecular formula of 4-(5-fluoro-1H-indol-3-yl)butanoic acid? |
| A: Molecular formula of 4-(5-fluoro-1H-indol-3-yl)butanoic acid is C12H12FNO2. |
| Q: What English synonyms does 4-(5-fluoro-1H-indol-3-yl)butanoic acid have? |
| A: English synonyms of 4-(5-fluoro-1H-indol-3-yl)butanoic acid: 4-(5-fluoroindol-3-yl)butanoic acid, 4-(5-Fluoro-1H-indol-3-yl)-butyric acid, 4-(5-fluoro-indol-3-yl)-butyric acid, 1H-Indole-3-butanoicacid,5-fluoro, 5-fluoro-3-(3-carboxypropyl)-1H-indole, MFCD03839847, 5-Fluoroindole-3-butyric acid, 4-(5-Fluor-indol-3-yl)-buttersaeure, 4-(5-Fluoro-1H-indol-3-yl)butanoic acid. |
| Q: What is the LogP of 4-(5-fluoro-1H-indol-3-yl)butanoic acid? |
| A: LogP of 4-(5-fluoro-1H-indol-3-yl)butanoic acid is 2.48. |
| Q: What is the InChIKey of 4-(5-fluoro-1H-indol-3-yl)butanoic acid? |
| A: InChIKey of 4-(5-fluoro-1H-indol-3-yl)butanoic acid is IJAVCLNGRFTCBG-UHFFFAOYSA-N. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |