1,2-DIFLUORO-4-(ISOCYANO(TOSYL)METHYL)BENZENE
1,2-DIFLUORO-4-(ISOCYANO(TOSYL)METHYL)BENZENE structure
|
Common Name | 1,2-DIFLUORO-4-(ISOCYANO(TOSYL)METHYL)BENZENE | ||
|---|---|---|---|---|
| CAS Number | 321345-37-3 | Molecular Weight | 307.31500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H11F2NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,2-difluoro-4-[isocyano-(4-methylphenyl)sulfonylmethyl]benzene |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H11F2NO2S |
|---|---|
| Molecular Weight | 307.31500 |
| Exact Mass | 307.04800 |
| PSA | 42.52000 |
| LogP | 3.97650 |
| InChIKey | DUHMNGGUXBLMCW-UHFFFAOYSA-N |
| SMILES | [C-]#[N+]C(c1ccc(F)c(F)c1)S(=O)(=O)c1ccc(C)cc1 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| a5783 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 1,2-difluoro-4-[isocyano-(4-methylphenyl)sulfonylmethyl]benzene? |
| A: Molecular formula of 1,2-difluoro-4-[isocyano-(4-methylphenyl)sulfonylmethyl]benzene is C15H11F2NO2S. |
| Q: What is the CAS number of 1,2-difluoro-4-[isocyano-(4-methylphenyl)sulfonylmethyl]benzene? |
| A: CAS number of 1,2-difluoro-4-[isocyano-(4-methylphenyl)sulfonylmethyl]benzene is 321345-37-3. |
| Q: What is the LogP of 1,2-difluoro-4-[isocyano-(4-methylphenyl)sulfonylmethyl]benzene? |
| A: LogP of 1,2-difluoro-4-[isocyano-(4-methylphenyl)sulfonylmethyl]benzene is 3.97650. |
| Q: What is the SMILES notation of 1,2-difluoro-4-[isocyano-(4-methylphenyl)sulfonylmethyl]benzene? |
| A: SMILES notation of 1,2-difluoro-4-[isocyano-(4-methylphenyl)sulfonylmethyl]benzene is [C-]#[N+]C(c1ccc(F)c(F)c1)S(=O)(=O)c1ccc(C)cc1. |
| Q: What is the English name of 1,2-difluoro-4-[isocyano-(4-methylphenyl)sulfonylmethyl]benzene? |
| A: The English name of 1,2-difluoro-4-[isocyano-(4-methylphenyl)sulfonylmethyl]benzene is 1,2-difluoro-4-[isocyano-(4-methylphenyl)sulfonylmethyl]benzene. |
| Q: What English synonyms does 1,2-difluoro-4-[isocyano-(4-methylphenyl)sulfonylmethyl]benzene have? |
| A: English synonyms of 1,2-difluoro-4-[isocyano-(4-methylphenyl)sulfonylmethyl]benzene: a5783. |
| Q: What is the molecular weight of 1,2-difluoro-4-[isocyano-(4-methylphenyl)sulfonylmethyl]benzene? |
| A: Molecular weight of 1,2-difluoro-4-[isocyano-(4-methylphenyl)sulfonylmethyl]benzene is 307.31500. |
| Q: What is the InChIKey of 1,2-difluoro-4-[isocyano-(4-methylphenyl)sulfonylmethyl]benzene? |
| A: InChIKey of 1,2-difluoro-4-[isocyano-(4-methylphenyl)sulfonylmethyl]benzene is DUHMNGGUXBLMCW-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of 1,2-difluoro-4-[isocyano-(4-methylphenyl)sulfonylmethyl]benzene? |
| A: Polar surface area (PSA) of 1,2-difluoro-4-[isocyano-(4-methylphenyl)sulfonylmethyl]benzene is 42.52000. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |