3-[1-(3-chloropropyl)-4-piperidinyl]-6-fluoro-1,2-benzisoxazole
![3-[1-(3-chloropropyl)-4-piperidinyl]-6-fluoro-1,2-benzisoxazole Structure](https://image.chemsrc.com/caspic/160/329977-73-3.png)
3-[1-(3-chloropropyl)-4-piperidinyl]-6-fluoro-1,2-benzisoxazole structure
|
Common Name | 3-[1-(3-chloropropyl)-4-piperidinyl]-6-fluoro-1,2-benzisoxazole | ||
|---|---|---|---|---|
| CAS Number | 329977-73-3 | Molecular Weight | 296.76800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H18ClFN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-[1-(3-chloropropyl)-4-piperidinyl]-6-fluoro-1,2-benzisoxazole |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H18ClFN2O |
|---|---|
| Molecular Weight | 296.76800 |
| Exact Mass | 296.10900 |
| PSA | 29.27000 |
| LogP | 3.71310 |
| InChIKey | NLSKESNFYRUZEB-UHFFFAOYSA-N |
| SMILES | Fc1ccc2c(C3CCN(CCCCl)CC3)noc2c1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:133454-47-4This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of 3-[1-(3-chloropropyl)-4-piperidinyl]-6-fluoro-1,2-benzisoxazole? |
| A: Polar surface area (PSA) of 3-[1-(3-chloropropyl)-4-piperidinyl]-6-fluoro-1,2-benzisoxazole is 29.27000. |
| Q: What is the English name of 3-[1-(3-chloropropyl)-4-piperidinyl]-6-fluoro-1,2-benzisoxazole? |
| A: The English name of 3-[1-(3-chloropropyl)-4-piperidinyl]-6-fluoro-1,2-benzisoxazole is 3-[1-(3-chloropropyl)-4-piperidinyl]-6-fluoro-1,2-benzisoxazole. |
| Q: What is the SMILES notation of 3-[1-(3-chloropropyl)-4-piperidinyl]-6-fluoro-1,2-benzisoxazole? |
| A: SMILES notation of 3-[1-(3-chloropropyl)-4-piperidinyl]-6-fluoro-1,2-benzisoxazole is Fc1ccc2c(C3CCN(CCCCl)CC3)noc2c1. |
| Q: What is the InChIKey of 3-[1-(3-chloropropyl)-4-piperidinyl]-6-fluoro-1,2-benzisoxazole? |
| A: InChIKey of 3-[1-(3-chloropropyl)-4-piperidinyl]-6-fluoro-1,2-benzisoxazole is NLSKESNFYRUZEB-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 329977-73-3? |
| A: Chinese name of 329977-73-3 is 329977-73-3. |
| Q: What is the CAS number of 3-[1-(3-chloropropyl)-4-piperidinyl]-6-fluoro-1,2-benzisoxazole? |
| A: CAS number of 3-[1-(3-chloropropyl)-4-piperidinyl]-6-fluoro-1,2-benzisoxazole is 329977-73-3. |
| Q: What are the downstream products of 3-[1-(3-chloropropyl)-4-piperidinyl]-6-fluoro-1,2-benzisoxazole? |
| A: Related downstream products(CAS) of 3-[1-(3-chloropropyl)-4-piperidinyl]-6-fluoro-1,2-benzisoxazole: 133454-47-4. |
| Q: What is the molecular formula of 3-[1-(3-chloropropyl)-4-piperidinyl]-6-fluoro-1,2-benzisoxazole? |
| A: Molecular formula of 3-[1-(3-chloropropyl)-4-piperidinyl]-6-fluoro-1,2-benzisoxazole is C15H18ClFN2O. |
| Q: What is the molecular weight of 3-[1-(3-chloropropyl)-4-piperidinyl]-6-fluoro-1,2-benzisoxazole? |
| A: Molecular weight of 3-[1-(3-chloropropyl)-4-piperidinyl]-6-fluoro-1,2-benzisoxazole is 296.76800. |
| Q: What is the LogP of 3-[1-(3-chloropropyl)-4-piperidinyl]-6-fluoro-1,2-benzisoxazole? |
| A: LogP of 3-[1-(3-chloropropyl)-4-piperidinyl]-6-fluoro-1,2-benzisoxazole is 3.71310. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |